EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H50O |
| Net Charge | 0 |
| Average Mass | 426.729 |
| Monoisotopic Mass | 426.38617 |
| SMILES | [H][C@@]12CCC3=C(CC[C@@]4(C)C3CC[C@]4([H])[C@H](C)CCC(=C)C(C)C)[C@@]1(C)CC[C@H](O)C2(C)C |
| InChI | InChI=1S/C30H50O/c1-19(2)20(3)9-10-21(4)23-12-13-24-22-11-14-26-28(5,6)27(31)16-18-30(26,8)25(22)15-17-29(23,24)7/h19,21,23-24,26-27,31H,3,9-18H2,1-2,4-8H3/t21-,23-,24?,26+,27+,29-,30-/m1/s1 |
| InChIKey | UEWBRSZKEWLYPN-FWUVKINLSA-N |
| Roles Classification |
|---|
| Biological Role: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4,4,24-trimethylcholesta-8,24(28)-dien-3β-ol (CHEBI:176893) has functional parent eburicol (CHEBI:70315) |
| 4,4,24-trimethylcholesta-8,24(28)-dien-3β-ol (CHEBI:176893) has role fungal metabolite (CHEBI:76946) |
| 4,4,24-trimethylcholesta-8,24(28)-dien-3β-ol (CHEBI:176893) is a 3β-sterol (CHEBI:35348) |
| UniProt Name | Source |
|---|---|
| 4,4,24-trimethylcholesta-8,24(28)-dien-3β-ol | UniProt |
| Citations |
|---|