EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H17NO7 |
| Net Charge | 0 |
| Average Mass | 251.235 |
| Monoisotopic Mass | 251.10050 |
| SMILES | C[C@@H](O[C@H]1[C@H](O)[C@@H](CO)OC(O)[C@@H]1N)C(=O)O |
| InChI | InChI=1S/C9H17NO7/c1-3(8(13)14)16-7-5(10)9(15)17-4(2-11)6(7)12/h3-7,9,11-12,15H,2,10H2,1H3,(H,13,14)/t3-,4-,5-,6-,7-,9?/m1/s1 |
| InChIKey | MSFSPUZXLOGKHJ-PGYHGBPZSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-amino-3-O-[(R)-1-carboxyethyl]-2-deoxy-D-glucopyranose (CHEBI:7027) has functional parent 2-amino-2-deoxy-D-glucopyranose (CHEBI:47977) |
| 2-amino-3-O-[(R)-1-carboxyethyl]-2-deoxy-D-glucopyranose (CHEBI:7027) is a muramic acid (CHEBI:28118) |
| Incoming Relation(s) |
| N-acetyl-D-muramic acid (CHEBI:21615) has functional parent 2-amino-3-O-[(R)-1-carboxyethyl]-2-deoxy-D-glucopyranose (CHEBI:7027) |
| β-D-GlcpNAc-(1→4)-Mur (CHEBI:184124) has functional parent 2-amino-3-O-[(R)-1-carboxyethyl]-2-deoxy-D-glucopyranose (CHEBI:7027) |
| α-muramic acid (CHEBI:47969) is a 2-amino-3-O-[(R)-1-carboxyethyl]-2-deoxy-D-glucopyranose (CHEBI:7027) |
| β-muramic acid (CHEBI:44312) is a 2-amino-3-O-[(R)-1-carboxyethyl]-2-deoxy-D-glucopyranose (CHEBI:7027) |
| IUPAC Name |
|---|
| 2-amino-3-O-[(1R)-1-carboxyethyl]-2-deoxy-D-glucopyranose |
| Synonyms | Source |
|---|---|
| 2-Amino-3-O-D-1-carboxyethyl-2-deoxy-D-glucose | KEGG COMPOUND |
| 3-O-alpha-Carboxyethyl-D-glucosamine | KEGG COMPOUND |
| Muramic acid | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C06470 | KEGG COMPOUND |
| Muramic_acid | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2334586 | Reaxys |
| CAS:484-57-1 | ChemIDplus |