EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H13NO5 |
| Net Charge | 0 |
| Average Mass | 179.172 |
| Monoisotopic Mass | 179.07937 |
| SMILES | N[C@H]1C(O)O[C@H](CO)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C6H13NO5/c7-3-5(10)4(9)2(1-8)12-6(3)11/h2-6,8-11H,1,7H2/t2-,3-,4-,5-,6?/m1/s1 |
| InChIKey | MSWZFWKMSRAUBD-IVMDWMLBSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Escherichia coli (ncbitaxon:562) | - | PubMed (21988831) | |
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Biological Roles: | Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| Application: | geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-amino-2-deoxy-D-glucopyranose (CHEBI:47977) has functional parent D-glucopyranose (CHEBI:4167) |
| 2-amino-2-deoxy-D-glucopyranose (CHEBI:47977) has role Escherichia coli metabolite (CHEBI:76971) |
| 2-amino-2-deoxy-D-glucopyranose (CHEBI:47977) has role geroprotector (CHEBI:176497) |
| 2-amino-2-deoxy-D-glucopyranose (CHEBI:47977) has role mouse metabolite (CHEBI:75771) |
| 2-amino-2-deoxy-D-glucopyranose (CHEBI:47977) is a D-glucosamine (CHEBI:17315) |
| 2-amino-2-deoxy-D-glucopyranose (CHEBI:47977) is conjugate base of 2-ammonio-2-deoxy-D-glucopyranose (CHEBI:58723) |
| Incoming Relation(s) |
| 2-amino-3-O-[(R)-1-carboxyethyl]-2-deoxy-D-glucopyranose (CHEBI:7027) has functional parent 2-amino-2-deoxy-D-glucopyranose (CHEBI:47977) |
| α-D-GlcpN-(1→6)-D-GlcpN (CHEBI:150211) has functional parent 2-amino-2-deoxy-D-glucopyranose (CHEBI:47977) |
| β-D-Galp-(1→3)-D-GlcpN (CHEBI:152182) has functional parent 2-amino-2-deoxy-D-glucopyranose (CHEBI:47977) |
| β-D-GlcN-(1→6)-D-GlcN (CHEBI:146542) has functional parent 2-amino-2-deoxy-D-glucopyranose (CHEBI:47977) |
| α-D-glucosamine (CHEBI:44678) is a 2-amino-2-deoxy-D-glucopyranose (CHEBI:47977) |
| β-D-glucosamine (CHEBI:28393) is a 2-amino-2-deoxy-D-glucopyranose (CHEBI:47977) |
| 2-ammonio-2-deoxy-D-glucopyranose (CHEBI:58723) is conjugate acid of 2-amino-2-deoxy-D-glucopyranose (CHEBI:47977) |
| [4)-D-GlcpN-(1→] residue (CHEBI:65272) is substituent group from 2-amino-2-deoxy-D-glucopyranose (CHEBI:47977) |
| IUPAC Name |
|---|
| 2-amino-2-deoxy-D-glucopyranose |
| Synonyms | Source |
|---|---|
| 2-Amino-2-deoxy-D-glucose | KEGG COMPOUND |
| Chitosamine | KEGG COMPOUND |
| D-Glucosamine | KEGG COMPOUND |
| Citations |
|---|