EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H17NO7 |
| Net Charge | 0 |
| Average Mass | 251.235 |
| Monoisotopic Mass | 251.10050 |
| SMILES | C[C@@H](O[C@@H]1[C@@H](N)[C@@H](O)O[C@H](CO)[C@H]1O)C(=O)O |
| InChI | InChI=1S/C9H17NO7/c1-3(8(13)14)16-7-5(10)9(15)17-4(2-11)6(7)12/h3-7,9,11-12,15H,2,10H2,1H3,(H,13,14)/t3-,4-,5-,6-,7-,9+/m1/s1 |
| InChIKey | MSFSPUZXLOGKHJ-GLPGPYIRSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| α-muramic acid (CHEBI:47969) has functional parent α-D-glucosamine (CHEBI:44678) |
| α-muramic acid (CHEBI:47969) is a 2-amino-3-O-[(R)-1-carboxyethyl]-2-deoxy-D-glucopyranose (CHEBI:7027) |
| IUPAC Name |
|---|
| 2-amino-3-O-[(1R)-1-carboxyethyl]-2-deoxy-α-D-glucopyranose |
| Synonym | Source |
|---|---|
| 2-amino-3-O-[(R)-1-carboxyethyl]-2-deoxy-α-D-glucopyranose | JCBN |
| Registry Numbers | Sources |
|---|---|
| Beilstein:1714864 | Beilstein |