EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C59H96O26 |
| Net Charge | 0 |
| Average Mass | 1221.391 |
| Monoisotopic Mass | 1220.61898 |
| SMILES | [H][C@@]1(O[C@H]2[C@H](O)[C@@H](O)[C@H](OC[C@H]3O[C@@H](OC(=O)[C@]45CCC(C)(C)C[C@@]4([H])C4=CC[C@]6([H])[C@@]7(C)CC[C@H](O[C@]8([H])OC[C@H](O)[C@H](O)[C@@]8([H])O[C@@H]8O[C@@H](C)[C@H](O)[C@@H](O)[C@H]8O)[C@@](C)(CO)[C@]7([H])CC[C@@]6(C)[C@]4(C)CC5)[C@H](O)[C@@H](O)[C@@H]3O)O[C@@H]2CO)O[C@@H](C)[C@H](O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C59H96O26/c1-24-34(63)38(67)42(71)49(78-24)83-46-29(20-60)80-48(45(74)41(46)70)77-22-30-37(66)40(69)44(73)51(81-30)85-53(75)59-17-15-54(3,4)19-27(59)26-9-10-32-55(5)13-12-33(56(6,23-61)31(55)11-14-58(32,8)57(26,7)16-18-59)82-52-47(36(65)28(62)21-76-52)84-50-43(72)39(68)35(64)25(2)79-50/h9,24-25,27-52,60-74H,10-23H2,1-8H3/t24-,25-,27-,28-,29+,30+,31+,32+,33-,34-,35-,36-,37+,38+,39+,40-,41+,42+,43+,44+,45+,46+,47+,48+,49-,50-,51-,52-,55-,56-,57+,58+,59-/m0/s1 |
| InChIKey | RYHDIBJJJRNDSX-MCGLQMIESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Kalopanax pictus (ncbitaxon:46399) | stem (BTO:0001300) | PubMed (21870831) | Previous component: stem bark; Hot MeOH extract of dried stem bark |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| kalopanaxsaponin B (CHEBI:69371) has functional parent hederagenin (CHEBI:69579) |
| kalopanaxsaponin B (CHEBI:69371) has role anti-inflammatory agent (CHEBI:67079) |
| kalopanaxsaponin B (CHEBI:69371) has role plant metabolite (CHEBI:76924) |
| kalopanaxsaponin B (CHEBI:69371) is a carboxylic ester (CHEBI:33308) |
| kalopanaxsaponin B (CHEBI:69371) is a pentacyclic triterpenoid (CHEBI:25872) |
| kalopanaxsaponin B (CHEBI:69371) is a triterpenoid saponin (CHEBI:61778) |
| IUPAC Name |
|---|
| 6-deoxy-α-L-mannopyranosyl-(1→4)-β-D-glucopyranosyl-(1→6)-1-O-[(3β)-3-{[2-O-(6-deoxy-α-L-mannopyranosyl)-α-L-arabinopyranosyl]oxy}-23-hydroxy-28-oxoolean-12-en-28-yl]-β-D-glucopyranose |
| Synonyms | Source |
|---|---|
| akebia saponin PK | ChemIDplus |
| akeboside Sth | ChemIDplus |
| glycoside L-H2 | ChemIDplus |
| hederacoside C | ChemIDplus |
| hederagenin 3-O-α-L-rhamnopyranosyl-(1→2)-O-α-L-arabinopyranoside 28-O-α-L-rhamnopyranosyl-(1→4)-O-β-D-glucopyranosyl-(1→6)-O-β-D-glucopyranosyl ester | ChEBI |
| hederoside H1 | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4229541 | Reaxys |
| CAS:14216-03-6 | ChemIDplus |
| Citations |
|---|