EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H15NO3 |
| Net Charge | 0 |
| Average Mass | 197.234 |
| Monoisotopic Mass | 197.10519 |
| SMILES | COc1ccc(OC)c(C(O)CN)c1 |
| InChI | InChI=1S/C10H15NO3/c1-13-7-3-4-10(14-2)8(5-7)9(12)6-11/h3-5,9,12H,6,11H2,1-2H3 |
| InChIKey | VFRCNXKYZVQYLX-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | sympathomimetic agent A drug that mimics the effects of stimulating postganglionic adrenergic sympathetic nerves. Included in this class are drugs that directly stimulate adrenergic receptors and drugs that act indirectly by provoking the release of adrenergic transmitters. alpha-adrenergic agonist An agent that selectively binds to and activates α-adrenergic receptors. |
| Applications: | vasoconstrictor agent Drug used to cause constriction of the blood vessels. sympathomimetic agent A drug that mimics the effects of stimulating postganglionic adrenergic sympathetic nerves. Included in this class are drugs that directly stimulate adrenergic receptors and drugs that act indirectly by provoking the release of adrenergic transmitters. alpha-adrenergic agonist An agent that selectively binds to and activates α-adrenergic receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| deglymidodrine (CHEBI:73248) has role sympathomimetic agent (CHEBI:35524) |
| deglymidodrine (CHEBI:73248) has role vasoconstrictor agent (CHEBI:50514) |
| deglymidodrine (CHEBI:73248) has role α-adrenergic agonist (CHEBI:35569) |
| deglymidodrine (CHEBI:73248) is a aromatic ether (CHEBI:35618) |
| deglymidodrine (CHEBI:73248) is a primary amino compound (CHEBI:50994) |
| deglymidodrine (CHEBI:73248) is a secondary alcohol (CHEBI:35681) |
| Incoming Relation(s) |
| midodrine (CHEBI:6933) has functional parent deglymidodrine (CHEBI:73248) |
| IUPAC Name |
|---|
| rac-2-amino-1-(2,5-dimethoxyphenyl)ethanol |
| Synonyms | Source |
|---|---|
| 1-(2',5'-dimethoxyphenyl)aminoethanol | ChemIDplus |
| (+/-)-2-amino-1-(2,5-dimethoxyphenyl)ethanol | ChEBI |
| (±)-2-amino-1-(2,5-dimethoxyphenyl)ethanol | ChEBI |
| de-glymidodrine | ChEBI |
| desglymidodrine | ChemIDplus |
| ST-1059 | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3262168 | Reaxys |
| CAS:3600-87-1 | ChemIDplus |
| Citations |
|---|