EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H38O6 |
| Net Charge | 0 |
| Average Mass | 470.606 |
| Monoisotopic Mass | 470.26684 |
| SMILES | [H][C@@]12C[C@H]3O[C@]34[C@@H](O)C=CC(=O)[C@]4(C)[C@@]1([H])CC[C@@]1(C)[C@@]2([H])CC[C@]1([H])[C@H](C)[C@@]1([H])CC(C)=C(CO)C(=O)O1 |
| InChI | InChI=1S/C28H38O6/c1-14-11-21(33-25(32)17(14)13-29)15(2)18-5-6-19-16-12-24-28(34-24)23(31)8-7-22(30)27(28,4)20(16)9-10-26(18,19)3/h7-8,15-16,18-21,23-24,29,31H,5-6,9-13H2,1-4H3/t15-,16-,18+,19-,20-,21+,23-,24+,26+,27-,28+/m0/s1 |
| InChIKey | DBRXOUCRJQVYJQ-CKNDUULBSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Physalis longifolia (ncbitaxon:161495) | aerial part (BTO:0001658) | PubMed (22098611) | CH2Cl2-MeOH(1:1) extract of the air-dried aerial parts |
| Roles Classification |
|---|
| Biological Roles: | apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| withaferin A (CHEBI:69120) has role antineoplastic agent (CHEBI:35610) |
| withaferin A (CHEBI:69120) has role apoptosis inducer (CHEBI:68495) |
| withaferin A (CHEBI:69120) is a 27-hydroxy steroid (CHEBI:37914) |
| withaferin A (CHEBI:69120) is a 4-hydroxy steroid (CHEBI:62846) |
| withaferin A (CHEBI:69120) is a enone (CHEBI:51689) |
| withaferin A (CHEBI:69120) is a epoxy steroid (CHEBI:145217) |
| withaferin A (CHEBI:69120) is a ergostanoid (CHEBI:50403) |
| withaferin A (CHEBI:69120) is a primary alcohol (CHEBI:15734) |
| withaferin A (CHEBI:69120) is a secondary alcohol (CHEBI:35681) |
| withaferin A (CHEBI:69120) is a withanolide (CHEBI:74716) |
| withaferin A (CHEBI:69120) is a δ-lactone (CHEBI:18946) |
| Incoming Relation(s) |
| 2,3-dihydro-3β-O-sulfate withaferin A (CHEBI:69123) has functional parent withaferin A (CHEBI:69120) |
| 2,3-dihydro-3β-methoxy withaferin A (CHEBI:69121) has functional parent withaferin A (CHEBI:69120) |
| 2,3-dihydrowithaferin A (CHEBI:69124) has functional parent withaferin A (CHEBI:69120) |
| sitoindoside IX (CHEBI:69119) has functional parent withaferin A (CHEBI:69120) |
| withalongolide A (CHEBI:69106) has functional parent withaferin A (CHEBI:69120) |
| withalongolide B (CHEBI:69107) has functional parent withaferin A (CHEBI:69120) |
| withalongolide C (CHEBI:69108) has functional parent withaferin A (CHEBI:69120) |
| withalongolide G (CHEBI:69126) has functional parent withaferin A (CHEBI:69120) |
| withalongolide H (CHEBI:69112) has functional parent withaferin A (CHEBI:69120) |
| IUPAC Name |
|---|
| (4β,5β,6β,22R)-4,27-dihydroxy-5,6:22,26-diepoxyergosta-2,24-diene-1,26-dione |
| Synonyms | Source |
|---|---|
| 4β,27-dihydroxy-1-oxo-5β,6β-epoxywitha-2,24-dienolide | ChEBI |
| Withaferin A | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C00003676 | KNApSAcK |
| C08841 | KEGG COMPOUND |
| Withaferin_A | Wikipedia |
| WO2010030395 | Patent |
| WO2010053655 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6284722 | Reaxys |
| CAS:5119-48-2 | KEGG COMPOUND |
| CAS:5119-48-2 | ChemIDplus |
| Citations |
|---|