EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H38O7 |
| Net Charge | 0 |
| Average Mass | 486.605 |
| Monoisotopic Mass | 486.26175 |
| SMILES | [H][C@@]12C[C@H]3O[C@]34[C@@H](O)C=CC(=O)[C@]4(CO)[C@@]1([H])CC[C@@]1(C)[C@@]2([H])CC[C@]1([H])[C@H](C)[C@@]1([H])CC(C)=C(CO)C(=O)O1 |
| InChI | InChI=1S/C28H38O7/c1-14-10-21(34-25(33)17(14)12-29)15(2)18-4-5-19-16-11-24-28(35-24)23(32)7-6-22(31)27(28,13-30)20(16)8-9-26(18,19)3/h6-7,15-16,18-21,23-24,29-30,32H,4-5,8-13H2,1-3H3/t15-,16-,18+,19-,20-,21+,23-,24+,26+,27-,28+/m0/s1 |
| InChIKey | FJMXKFSOKLFYRC-CKNDUULBSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Physalis longifolia (ncbitaxon:161495) | aerial part (BTO:0001658) | PubMed (22098611) | CH2Cl2-MeOH(1:1) extract of the air-dried aerial parts |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| withalongolide A (CHEBI:69106) has functional parent withaferin A (CHEBI:69120) |
| withalongolide A (CHEBI:69106) has role antineoplastic agent (CHEBI:35610) |
| withalongolide A (CHEBI:69106) has role plant metabolite (CHEBI:76924) |
| withalongolide A (CHEBI:69106) is a 19-hydroxy steroid (CHEBI:36842) |
| withalongolide A (CHEBI:69106) is a 27-hydroxy steroid (CHEBI:37914) |
| withalongolide A (CHEBI:69106) is a 4-hydroxy steroid (CHEBI:62846) |
| withalongolide A (CHEBI:69106) is a enone (CHEBI:51689) |
| withalongolide A (CHEBI:69106) is a epoxy steroid (CHEBI:145217) |
| withalongolide A (CHEBI:69106) is a ergostanoid (CHEBI:50403) |
| withalongolide A (CHEBI:69106) is a primary alcohol (CHEBI:15734) |
| withalongolide A (CHEBI:69106) is a secondary alcohol (CHEBI:35681) |
| withalongolide A (CHEBI:69106) is a withanolide (CHEBI:74716) |
| withalongolide A (CHEBI:69106) is a δ-lactone (CHEBI:18946) |
| IUPAC Name |
|---|
| (4β,5β,6β,22R)-4,19,27-trihydroxy-5,6:22,26-diepoxyergosta-2,24-diene-1,26-dione |
| Synonym | Source |
|---|---|
| 19-hydroxywithaferin A | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:22217708 | Reaxys |
| Citations |
|---|