EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C34H48O11 |
| Net Charge | 0 |
| Average Mass | 632.747 |
| Monoisotopic Mass | 632.31966 |
| SMILES | [H][C@@]12C[C@H]3O[C@]34[C@@H](O)C=CC(=O)[C@]4(C)[C@@]1([H])CC[C@@]1(C)[C@@]2([H])CC[C@]1([H])[C@H](C)[C@@]1([H])CC(C)=C(CO[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)C(=O)O1 |
| InChI | InChI=1S/C34H48O11/c1-15-11-22(43-30(41)18(15)14-42-31-29(40)28(39)27(38)23(13-35)44-31)16(2)19-5-6-20-17-12-26-34(45-26)25(37)8-7-24(36)33(34,4)21(17)9-10-32(19,20)3/h7-8,16-17,19-23,25-29,31,35,37-40H,5-6,9-14H2,1-4H3/t16-,17-,19+,20-,21-,22+,23+,25-,26+,27+,28-,29+,31+,32+,33-,34+/m0/s1 |
| InChIKey | WKCJIGSUKSPCKI-WNXUODGFSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Physalis longifolia (ncbitaxon:161495) | aerial part (BTO:0001658) | PubMed (22098611) | CH2Cl2-MeOH(1:1) extract of the air-dried aerial parts |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sitoindoside IX (CHEBI:69119) has functional parent withaferin A (CHEBI:69120) |
| sitoindoside IX (CHEBI:69119) has role antineoplastic agent (CHEBI:35610) |
| sitoindoside IX (CHEBI:69119) has role plant metabolite (CHEBI:76924) |
| sitoindoside IX (CHEBI:69119) is a 4-hydroxy steroid (CHEBI:62846) |
| sitoindoside IX (CHEBI:69119) is a enone (CHEBI:51689) |
| sitoindoside IX (CHEBI:69119) is a epoxy steroid (CHEBI:145217) |
| sitoindoside IX (CHEBI:69119) is a ergostanoid (CHEBI:50403) |
| sitoindoside IX (CHEBI:69119) is a monosaccharide derivative (CHEBI:63367) |
| sitoindoside IX (CHEBI:69119) is a secondary alcohol (CHEBI:35681) |
| sitoindoside IX (CHEBI:69119) is a withanolide saponin (CHEBI:76344) |
| sitoindoside IX (CHEBI:69119) is a β-D-glucoside (CHEBI:22798) |
| sitoindoside IX (CHEBI:69119) is a δ-lactone (CHEBI:18946) |
| IUPAC Name |
|---|
| (4β,5β,6β,22R)-4-hydroxy-1,26-dioxo-5,6:22,26-diepoxyergosta-2,24-dien-27-yl β-D-glucopyranoside |
| Synonym | Source |
|---|---|
| 27-O-β-D-glucopyranosylwithaferin A | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8605359 | Reaxys |
| CAS:118853-45-5 | ChemIDplus |
| Citations |
|---|