EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H15ClF4N4O3 |
| Net Charge | 0 |
| Average Mass | 482.821 |
| Monoisotopic Mass | 482.07688 |
| SMILES | CNC(=O)c1cc(Oc2ccc(NC(=O)Nc3ccc(Cl)c(C(F)(F)F)c3)c(F)c2)ccn1 |
| InChI | InChI=1S/C21H15ClF4N4O3/c1-27-19(31)18-10-13(6-7-28-18)33-12-3-5-17(16(23)9-12)30-20(32)29-11-2-4-15(22)14(8-11)21(24,25)26/h2-10H,1H3,(H,27,31)(H2,29,30,32) |
| InChIKey | FNHKPVJBJVTLMP-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | hepatotoxic agent A role played by a chemical compound exhibiting itself through the ability to induce damage to the liver in animals. tyrosine kinase inhibitor Any protein kinase inhibitor that interferes with the action of tyrosine kinase. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| regorafenib (CHEBI:68647) has role antineoplastic agent (CHEBI:35610) |
| regorafenib (CHEBI:68647) has role hepatotoxic agent (CHEBI:50908) |
| regorafenib (CHEBI:68647) has role tyrosine kinase inhibitor (CHEBI:38637) |
| regorafenib (CHEBI:68647) is a (trifluoromethyl)benzenes (CHEBI:83565) |
| regorafenib (CHEBI:68647) is a aromatic ether (CHEBI:35618) |
| regorafenib (CHEBI:68647) is a monochlorobenzenes (CHEBI:83403) |
| regorafenib (CHEBI:68647) is a monofluorobenzenes (CHEBI:83575) |
| regorafenib (CHEBI:68647) is a phenylureas (CHEBI:134043) |
| regorafenib (CHEBI:68647) is a pyridinecarboxamide (CHEBI:25529) |
| Incoming Relation(s) |
| regorafenib hydrate (CHEBI:68646) has part regorafenib (CHEBI:68647) |
| IUPAC Name |
|---|
| 4-[4-({[4-chloro-3-(trifluoromethyl)phenyl]carbamoyl}amino)-3-fluorophenoxy]-N-methylpyridine-2-carboxamide |
| INNs | Source |
|---|---|
| regorafenib | KEGG DRUG |
| regorafenib | WHO MedNet |
| régorafénib | WHO MedNet |
| regorafenibum | WHO MedNet |
| Synonyms | Source |
|---|---|
| BAY 73-4506 | ChEBI |
| Regorafenibum | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 4654 | DrugCentral |
| D10138 | KEGG DRUG |
| LSM-1226 | LINCS |
| Regorafenib | Wikipedia |
| US2006058358 | Patent |
| WO2006125540 | Patent |
| WO2007054216 | Patent |
| WO2007068380 | Patent |
| WO2007068382 | Patent |
| WO2008043446 | Patent |
| WO2008055629 | Patent |
| WO2008058644 | Patent |
| WO2008089388 | Patent |
| WO2008089389 | Patent |
| WO2011128261 | Patent |
| WO2011130728 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:14359949 | Reaxys |
| CAS:755037-03-7 | ChemIDplus |
| CAS:755037-03-7 | KEGG DRUG |
| Citations |
|---|