EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H15ClF4N4O3.H2O |
| Net Charge | 0 |
| Average Mass | 500.836 |
| Monoisotopic Mass | 500.08745 |
| SMILES | CNC(=O)c1cc(Oc2ccc(NC(=O)Nc3ccc(Cl)c(C(F)(F)F)c3)c(F)c2)ccn1.O |
| InChI | InChI=1S/C21H15ClF4N4O3.H2O/c1-27-19(31)18-10-13(6-7-28-18)33-12-3-5-17(16(23)9-12)30-20(32)29-11-2-4-15(22)14(8-11)21(24,25)26;/h2-10H,1H3,(H,27,31)(H2,29,30,32);1H2 |
| InChIKey | ZOPOQLDXFHBOIH-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | hepatotoxic agent A role played by a chemical compound exhibiting itself through the ability to induce damage to the liver in animals. tyrosine kinase inhibitor Any protein kinase inhibitor that interferes with the action of tyrosine kinase. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| regorafenib hydrate (CHEBI:68646) has part regorafenib (CHEBI:68647) |
| regorafenib hydrate (CHEBI:68646) has role antineoplastic agent (CHEBI:35610) |
| regorafenib hydrate (CHEBI:68646) has role hepatotoxic agent (CHEBI:50908) |
| regorafenib hydrate (CHEBI:68646) has role tyrosine kinase inhibitor (CHEBI:38637) |
| regorafenib hydrate (CHEBI:68646) is a hydrate (CHEBI:35505) |
| IUPAC Name |
|---|
| 4-[4-({[4-chloro-3-(trifluoromethyl)phenyl]carbamoyl}amino)-3-fluorophenoxy]-N-methylpyridine-2-carboxamide—water (1/1) |
| Synonyms | Source |
|---|---|
| 4-[4-({[4-chloro-3-(trifluoromethyl)phenyl]carbamoyl}amino)-3-fluorophenoxy]-N-methylpyridine-2-carboxamide monohydrate | ChEBI |
| regorafenib monohydrate | ChEBI |
| Brand Name | Source |
|---|---|
| Stivarga | KEGG DRUG |
| Manual Xrefs | Databases |
|---|---|
| D10137 | KEGG DRUG |
| WO2008043446 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:18329444 | Reaxys |