EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H45O7S |
| Net Charge | -1 |
| Average Mass | 513.717 |
| Monoisotopic Mass | 513.28915 |
| SMILES | [H][C@@]12CC[C@]([H])([C@H](C)CCCC(C)C)[C@@]1(C)CC[C@]1([H])[C@@]34CC[C@H](OS(=O)(=O)[O-])C[C@]3(O)[C@H](O)C[C@@]21OC4 |
| InChI | InChI=1S/C27H46O7S/c1-17(2)6-5-7-18(3)20-8-9-21-24(20,4)12-11-22-25-13-10-19(34-35(30,31)32)14-27(25,29)23(28)15-26(21,22)33-16-25/h17-23,28-29H,5-16H2,1-4H3,(H,30,31,32)/p-1/t18-,19+,20-,21-,22-,23-,24-,25+,26-,27+/m1/s1 |
| InChIKey | MWTQCWZOXMULHF-QZSJCTLHSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| eurysterol A(1−) (CHEBI:68592) is a organosulfate oxoanion (CHEBI:58958) |
| eurysterol A(1−) (CHEBI:68592) is conjugate base of eurysterol A sulfonic acid (CHEBI:68591) |
| Incoming Relation(s) |
| eurysterol A (CHEBI:65888) has part eurysterol A(1−) (CHEBI:68592) |
| eurysterol A sulfonic acid (CHEBI:68591) is conjugate acid of eurysterol A(1−) (CHEBI:68592) |
| IUPAC Name |
|---|
| (3β,5α,6β)-5,6-dihydroxy-8,19-epoxycholestan-3-yl sulfate |
| Synonyms | Source |
|---|---|
| eurysterol A sulfate(1−) | ChEBI |
| eurysterol A sulfate anion | ChEBI |