EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H46O7S |
| Net Charge | 0 |
| Average Mass | 514.725 |
| Monoisotopic Mass | 514.29642 |
| SMILES | [H][C@@]12CC[C@]([H])([C@H](C)CCCC(C)C)[C@@]1(C)CC[C@]1([H])[C@@]34CC[C@H](OS(=O)(=O)O)C[C@]3(O)[C@H](O)C[C@@]21OC4 |
| InChI | InChI=1S/C27H46O7S/c1-17(2)6-5-7-18(3)20-8-9-21-24(20,4)12-11-22-25-13-10-19(34-35(30,31)32)14-27(25,29)23(28)15-26(21,22)33-16-25/h17-23,28-29H,5-16H2,1-4H3,(H,30,31,32)/t18-,19+,20-,21-,22-,23-,24-,25+,26-,27+/m1/s1 |
| InChIKey | MWTQCWZOXMULHF-QZSJCTLHSA-N |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| eurysterol A sulfonic acid (CHEBI:68591) has parent hydride 5α-cholestane (CHEBI:35515) |
| eurysterol A sulfonic acid (CHEBI:68591) has role antifungal agent (CHEBI:35718) |
| eurysterol A sulfonic acid (CHEBI:68591) has role antineoplastic agent (CHEBI:35610) |
| eurysterol A sulfonic acid (CHEBI:68591) has role metabolite (CHEBI:25212) |
| eurysterol A sulfonic acid (CHEBI:68591) is a 5α-hydroxy steroid (CHEBI:38194) |
| eurysterol A sulfonic acid (CHEBI:68591) is a 6β-hydroxy steroid (CHEBI:36851) |
| eurysterol A sulfonic acid (CHEBI:68591) is a bridged compound (CHEBI:35990) |
| eurysterol A sulfonic acid (CHEBI:68591) is a cyclic ether (CHEBI:37407) |
| eurysterol A sulfonic acid (CHEBI:68591) is a diol (CHEBI:23824) |
| eurysterol A sulfonic acid (CHEBI:68591) is a organic heteropentacyclic compound (CHEBI:38164) |
| eurysterol A sulfonic acid (CHEBI:68591) is a steroid sulfate (CHEBI:16158) |
| eurysterol A sulfonic acid (CHEBI:68591) is conjugate acid of eurysterol A(1−) (CHEBI:68592) |
| Incoming Relation(s) |
| eurysterol A(1−) (CHEBI:68592) is conjugate base of eurysterol A sulfonic acid (CHEBI:68591) |
| IUPAC Name |
|---|
| (3β,5α,6β)-5,6-dihydroxy-8,19-epoxycholestan-3-yl hydrogen sulfate |
| Synonyms | Source |
|---|---|
| (3β,5α,6β)-5,6-dihydroxy-8,19-epoxycholestan-3-yl sulfonic acid | ChEBI |
| eurysterol A hydrogen sulfate | ChEBI |