EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H45O7S.Na |
| Net Charge | 0 |
| Average Mass | 536.707 |
| Monoisotopic Mass | 536.27837 |
| SMILES | [H][C@@]12CC[C@]([H])([C@H](C)CCCC(C)C)[C@@]1(C)CC[C@]1([H])[C@@]34CC[C@H](OS(=O)(=O)[O-])C[C@]3(O)[C@H](O)C[C@@]21OC4.[Na+] |
| InChI | InChI=1S/C27H46O7S.Na/c1-17(2)6-5-7-18(3)20-8-9-21-24(20,4)12-11-22-25-13-10-19(34-35(30,31)32)14-27(25,29)23(28)15-26(21,22)33-16-25;/h17-23,28-29H,5-16H2,1-4H3,(H,30,31,32);/q;+1/p-1/t18-,19+,20-,21-,22-,23-,24-,25+,26-,27+;/m1./s1 |
| InChIKey | NPTYMHRTUPEDPI-WQTFAPJPSA-M |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Euryspongia (WORMS:164976) | - | PubMed (17378608) |
| Roles Classification |
|---|
| Biological Roles: | antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| eurysterol A (CHEBI:65888) has parent hydride 5α-cholestane (CHEBI:35515) |
| eurysterol A (CHEBI:65888) has part eurysterol A(1−) (CHEBI:68592) |
| eurysterol A (CHEBI:65888) has role antifungal agent (CHEBI:35718) |
| eurysterol A (CHEBI:65888) has role antineoplastic agent (CHEBI:35610) |
| eurysterol A (CHEBI:65888) has role metabolite (CHEBI:25212) |
| eurysterol A (CHEBI:65888) is a organic sodium salt (CHEBI:38700) |
| IUPAC Name |
|---|
| sodium (3β,5α,6β)-5,6-dihydroxy-8,19-epoxycholestan-3-yl sulfate |
| Synonym | Source |
|---|---|
| sodium 5α-cholestan-8,19-epoxy-3β,5,6β-triol-3-sulphate | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11166278 | Reaxys |
| Citations |
|---|