EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H10O2 |
| Net Charge | 0 |
| Average Mass | 162.188 |
| Monoisotopic Mass | 162.06808 |
| SMILES | [H]C(=Cc1ccccc1)C(=O)OC |
| InChI | InChI=1S/C10H10O2/c1-12-10(11)8-7-9-5-3-2-4-6-9/h2-8H,1H3 |
| InChIKey | CCRCUPLGCSFEDV-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Ocimum (ncbitaxon:39173) | - | DOI (10.1590/S0103-50532003000500008) | |
| Tricholoma matsutake (ncbitaxon:40145) | fruit body (BTO:0000487) | PubMed (18066606) | |
| Zanthoxylum armatum (ncbitaxon:67938) | - | PubMed (22273148) |
| Roles Classification |
|---|
| Biological Roles: | flavouring agent A food additive that is used to added improve the taste or odour of a food. insect attractant A chemical that attracts insects. volatile oil component Any plant metabolite that is found naturally as a component of a volatile oil. |
| Applications: | flavouring agent A food additive that is used to added improve the taste or odour of a food. anti-inflammatory agent Any compound that has anti-inflammatory effects. fragrance A substance, extract, or preparation for diffusing or imparting an agreeable or attractive smell. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| methyl cinnamate (CHEBI:6857) has role anti-inflammatory agent (CHEBI:67079) |
| methyl cinnamate (CHEBI:6857) has role flavouring agent (CHEBI:35617) |
| methyl cinnamate (CHEBI:6857) has role fragrance (CHEBI:48318) |
| methyl cinnamate (CHEBI:6857) has role insect attractant (CHEBI:24850) |
| methyl cinnamate (CHEBI:6857) has role volatile oil component (CHEBI:27311) |
| methyl cinnamate (CHEBI:6857) is a alkyl cinnamate (CHEBI:17958) |
| methyl cinnamate (CHEBI:6857) is a methyl ester (CHEBI:25248) |
| Incoming Relation(s) |
| methyl cis-cinnamate (CHEBI:194139) is a methyl cinnamate (CHEBI:6857) |
| methyl trans-cinnamate (CHEBI:194138) is a methyl cinnamate (CHEBI:6857) |
| IUPAC Name |
|---|
| methyl 3-phenylprop-2-enoate |
| Synonyms | Source |
|---|---|
| 3-phenyl-2-propenoic acid methyl ester | ChEBI |
| 3-phenylacrylic acid methyl ester | ChEBI |
| cinnamic acid methyl ester | ChemIDplus |
| cinnamic acid, methyl ester | ChemIDplus |
| FEMA 2698 | ChemIDplus |
| methyl 3-phenyl-2-propenoate | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C00053486 | KNApSAcK |
| C06358 | KEGG COMPOUND |
| FDB012001 | FooDB |
| HMDB0033833 | HMDB |
| Methyl_cinnamate | Wikipedia |
| Citations |
|---|