EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H10O2 |
| Net Charge | 0 |
| Average Mass | 162.188 |
| Monoisotopic Mass | 162.06808 |
| SMILES | COC(=O)/C=C\c1ccccc1 |
| InChI | InChI=1S/C10H10O2/c1-12-10(11)8-7-9-5-3-2-4-6-9/h2-8H,1H3/b8-7- |
| InChIKey | CCRCUPLGCSFEDV-FPLPWBNLSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cantinoa mutabilis (ncbitaxon:996322) | - | DOI (10.1080/10412905.2003.9712089) | Species also known as Hyptis mutabilis. |
| Ocimum americanum (ncbitaxon:204141) | - | DOI (10.1016/j.indcrop.2014.02.032) | |
| Ocimum basilicum (ncbitaxon:39350) | aerial part (BTO:0001658) | PubMed (19136915) | |
| Tricholoma matsutake (ncbitaxon:40145) | - | DOI (10.1007/s00217-020-03606-9) |
| Roles Classification |
|---|
| Chemical Role: | flavouring agent A food additive that is used to added improve the taste or odour of a food. |
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. flavouring agent A food additive that is used to added improve the taste or odour of a food. insect attractant A chemical that attracts insects. volatile oil component Any plant metabolite that is found naturally as a component of a volatile oil. |
| Applications: | anti-inflammatory agent Any compound that has anti-inflammatory effects. flavouring agent A food additive that is used to added improve the taste or odour of a food. fragrance A substance, extract, or preparation for diffusing or imparting an agreeable or attractive smell. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| methyl cis-cinnamate (CHEBI:194139) has functional parent cis-cinnamic acid (CHEBI:35699) |
| methyl cis-cinnamate (CHEBI:194139) has role plant metabolite (CHEBI:76924) |
| methyl cis-cinnamate (CHEBI:194139) is a methyl cinnamate (CHEBI:6857) |
| IUPAC Name |
|---|
| methyl (2Z)-3-phenylprop-2-enoate |
| Synonyms | Source |
|---|---|
| cis-cinnamic acid methyl ester | NIST Chemistry WebBook |
| cis-methyl 3-phenyl-2-propenoate | ChemIDplus |
| cis-methyl cinnamate | KNApSAcK |
| (Z)-3-phenyl-2-propenoic acid methyl ester | NIST Chemistry WebBook |
| (Z)-cinnamic acid methyl ester | NIST Chemistry WebBook |
| (Z)-methyl 3-phenylacrylate | NIST Chemistry WebBook |
| Manual Xrefs | Databases |
|---|---|
| C00060644 | KNApSAcK |
| Registry Numbers | Sources |
|---|---|
| CAS:19713-73-6 | NIST Chemistry WebBook |
| CAS:19713-73-6 | ChemIDplus |
| Citations |
|---|