EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H11NO2 |
| Net Charge | 0 |
| Average Mass | 165.192 |
| Monoisotopic Mass | 165.07898 |
| SMILES | NC(CC(=O)O)c1ccccc1 |
| InChI | InChI=1S/C9H11NO2/c10-8(6-9(11)12)7-4-2-1-3-5-7/h1-5,8H,6,10H2,(H,11,12) |
| InChIKey | UJOYFRCOTPUKAK-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-amino-3-phenylpropanoic acid (CHEBI:68528) is a β-amino acid (CHEBI:33706) |
| 3-amino-3-phenylpropanoic acid (CHEBI:68528) is tautomer of 3-ammonio-3-phenylpropanoate (CHEBI:68527) |
| Incoming Relation(s) |
| (R)-3-amino-3-phenylpropanoic acid (CHEBI:67172) is a 3-amino-3-phenylpropanoic acid (CHEBI:68528) |
| (S)-3-amino-3-phenylpropanoic acid (CHEBI:68525) is a 3-amino-3-phenylpropanoic acid (CHEBI:68528) |
| 3-ammonio-3-phenylpropanoate (CHEBI:68527) is tautomer of 3-amino-3-phenylpropanoic acid (CHEBI:68528) |
| IUPAC Name |
|---|
| 3-amino-3-phenylpropanoic acid |
| Synonyms | Source |
|---|---|
| 3-Amino-3-phenylpropionic acid | ChemIDplus |
| beta-Phenyl-beta-alanine | ChemIDplus |
| β-phenylalanine | ChEBI |
| β-phenyl-β-alanine | ChEBI |