EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H11NO2 |
| Net Charge | 0 |
| Average Mass | 165.192 |
| Monoisotopic Mass | 165.07898 |
| SMILES | [NH3+]C(CC(=O)[O-])c1ccccc1 |
| InChI | InChI=1S/C9H11NO2/c10-8(6-9(11)12)7-4-2-1-3-5-7/h1-5,8H,6,10H2,(H,11,12) |
| InChIKey | UJOYFRCOTPUKAK-UHFFFAOYSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-ammonio-3-phenylpropanoate (CHEBI:68527) is a amino-acid zwitterion (CHEBI:35238) |
| 3-ammonio-3-phenylpropanoate (CHEBI:68527) is tautomer of 3-amino-3-phenylpropanoic acid (CHEBI:68528) |
| Incoming Relation(s) |
| (R)-3-ammonio-3-phenylpropanoate (CHEBI:67158) is a 3-ammonio-3-phenylpropanoate (CHEBI:68527) |
| (S)-3-ammonio-3-phenylpropanoate (CHEBI:68506) is a 3-ammonio-3-phenylpropanoate (CHEBI:68527) |
| 3-amino-3-phenylpropanoic acid (CHEBI:68528) is tautomer of 3-ammonio-3-phenylpropanoate (CHEBI:68527) |
| IUPAC Name |
|---|
| 3-azaniumyl-3-phenylpropanoate |
| Synonyms | Source |
|---|---|
| 3-amino-3-phenylpropanoic acid zwitterion | ChEBI |
| β-phenylalanine zwitterion | ChEBI |