EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H11NO2 |
| Net Charge | 0 |
| Average Mass | 165.192 |
| Monoisotopic Mass | 165.07898 |
| SMILES | N[C@H](CC(=O)O)c1ccccc1 |
| InChI | InChI=1S/C9H11NO2/c10-8(6-9(11)12)7-4-2-1-3-5-7/h1-5,8H,6,10H2,(H,11,12)/t8-/m1/s1 |
| InChIKey | UJOYFRCOTPUKAK-MRVPVSSYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (R)-3-amino-3-phenylpropanoic acid (CHEBI:67172) is a 3-amino-3-phenylpropanoic acid (CHEBI:68528) |
| (R)-3-amino-3-phenylpropanoic acid (CHEBI:67172) is enantiomer of (S)-3-amino-3-phenylpropanoic acid (CHEBI:68525) |
| (R)-3-amino-3-phenylpropanoic acid (CHEBI:67172) is tautomer of (R)-3-ammonio-3-phenylpropanoate (CHEBI:67158) |
| Incoming Relation(s) |
| (3R)-3-amino-3-phenylpropanoyl-CoA (CHEBI:83170) has functional parent (R)-3-amino-3-phenylpropanoic acid (CHEBI:67172) |
| (S)-3-amino-3-phenylpropanoic acid (CHEBI:68525) is enantiomer of (R)-3-amino-3-phenylpropanoic acid (CHEBI:67172) |
| (R)-3-ammonio-3-phenylpropanoate (CHEBI:67158) is tautomer of (R)-3-amino-3-phenylpropanoic acid (CHEBI:67172) |
| IUPAC Name |
|---|
| (3R)-3-amino-3-phenylpropanoic acid |
| Synonym | Source |
|---|---|
| (R)-β-phenylalanine | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2087717 | Reaxys |