EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H12N4O2 |
| Net Charge | 0 |
| Average Mass | 208.221 |
| Monoisotopic Mass | 208.09603 |
| SMILES | CCCn1c(=O)n(C)c(=O)c2ncnc21 |
| InChI | InChI=1S/C9H12N4O2/c1-3-4-13-7-6(10-5-11-7)8(14)12(2)9(13)15/h5H,3-4H2,1-2H3,(H,10,11) |
| InChIKey | MCPROACZLSAAPY-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | bronchodilator agent An agent that causes an increase in the expansion of a bronchus or bronchial tubes. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-methyl-3-propyl-7H-xanthine (CHEBI:145517) has functional parent 1-methyl-7H-xanthine (CHEBI:68444) |
| 1-methyl-3-propyl-7H-xanthine (CHEBI:145517) has functional parent enprofylline (CHEBI:126237) |
| 1-methyl-3-propyl-7H-xanthine (CHEBI:145517) has role bronchodilator agent (CHEBI:35523) |
| 1-methyl-3-propyl-7H-xanthine (CHEBI:145517) is a oxopurine (CHEBI:25810) |
| IUPAC Name |
|---|
| 1-methyl-3-propyl-3,7-dihydro-1H-purine-2,6-dione |
| Synonyms | Source |
|---|---|
| 1-methyl-3-n-propylxanthine | ChEBI |
| 1-methyl-3-propyl-7H-purine-2,6-dione | ChEBI |
| 1-methyl-3-propylxanthine | ChEBI |
| 3,7-dihydro-1-methyl-3-propyl-1H-purine-2,6-dione | ChemIDplus |
| MPX | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:118024-67-2 | ChemIDplus |
| Citations |
|---|