EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H30N2O2 |
| Net Charge | 0 |
| Average Mass | 378.516 |
| Monoisotopic Mass | 378.23073 |
| SMILES | CCN1CC(CCN2CCOCC2)C(c2ccccc2)(c2ccccc2)C1=O |
| InChI | InChI=1S/C24H30N2O2/c1-2-26-19-22(13-14-25-15-17-28-18-16-25)24(23(26)27,20-9-5-3-6-10-20)21-11-7-4-8-12-21/h3-12,22H,2,13-19H2,1H3 |
| InChIKey | XFDJYSQDBULQSI-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Applications: | central nervous system stimulant Any drug that enhances the activity of the central nervous system. antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| doxapram (CHEBI:681848) has role antidepressant (CHEBI:35469) |
| doxapram (CHEBI:681848) has role central nervous system stimulant (CHEBI:35337) |
| doxapram (CHEBI:681848) is a morpholines (CHEBI:38785) |
| doxapram (CHEBI:681848) is a pyrrolidin-2-ones (CHEBI:74223) |
| Incoming Relation(s) |
| doxapram hydrochloride (anhydrous) (CHEBI:59837) has part doxapram (CHEBI:681848) |
| (R)-doxapram (CHEBI:59842) is a doxapram (CHEBI:681848) |
| (S)-doxapram (CHEBI:59843) is a doxapram (CHEBI:681848) |
| IUPAC Name |
|---|
| 1-ethyl-4-[2-(morpholin-4-yl)ethyl]-3,3-diphenylpyrrolidin-2-one |
| INNs | Source |
|---|---|
| doxapram | WHO MedNet |
| doxapram | KEGG DRUG |
| doxapram | WHO MedNet |
| Synonyms | Source |
|---|---|
| 1-ethyl-4-(2-morpholinoethyl)-3,3-diphenyl-2-pyrrolidinone | ChemIDplus |
| Docatone | ChEMBL |
| (±)-doxapram | ChEBI |
| Doxapram | ChEMBL |
| Citations |
|---|