EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H30N2O2 |
| Net Charge | 0 |
| Average Mass | 378.516 |
| Monoisotopic Mass | 378.23073 |
| SMILES | CCN1C[C@@H](CCN2CCOCC2)C(c2ccccc2)(c2ccccc2)C1=O |
| InChI | InChI=1S/C24H30N2O2/c1-2-26-19-22(13-14-25-15-17-28-18-16-25)24(23(26)27,20-9-5-3-6-10-20)21-11-7-4-8-12-21/h3-12,22H,2,13-19H2,1H3/t22-/m1/s1 |
| InChIKey | XFDJYSQDBULQSI-JOCHJYFZSA-N |
| Roles Classification |
|---|
| Application: | central nervous system stimulant Any drug that enhances the activity of the central nervous system. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (S)-doxapram (CHEBI:59843) is a doxapram (CHEBI:681848) |
| (S)-doxapram (CHEBI:59843) is enantiomer of (R)-doxapram (CHEBI:59842) |
| Incoming Relation(s) |
| (R)-doxapram (CHEBI:59842) is enantiomer of (S)-doxapram (CHEBI:59843) |
| IUPAC Name |
|---|
| (4S)-1-ethyl-4-[2-(morpholin-4-yl)ethyl]-3,3-diphenylpyrrolidin-2-one |