EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H28O8 |
| Net Charge | 0 |
| Average Mass | 420.458 |
| Monoisotopic Mass | 420.17842 |
| SMILES | COc1cc([C@H]2c3c(cc(OC)c(O)c3OC)C[C@@H](CO)[C@@H]2CO)cc(OC)c1O |
| InChI | InChI=1S/C22H28O8/c1-27-15-7-12(8-16(28-2)20(15)25)18-14(10-24)13(9-23)5-11-6-17(29-3)21(26)22(30-4)19(11)18/h6-8,13-14,18,23-26H,5,9-10H2,1-4H3/t13-,14-,18+/m0/s1 |
| InChIKey | ZDVZKBOFCHOPLM-SUNYJGFJSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Machilus robusta (ncbitaxon:460780) | bark (BTO:0001301) | PubMed (21627109) | 95%aqueous EtOH extract of air-dried bark |
| Sinocalamus affinis (IPNI:421970-1) | stem (BTO:0001300) | PubMed (21469695) | 95% Ethanolic extract of skin-removed, air-dried, powdered stems. |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (+)-lyoniresinol (CHEBI:68168) has role antineoplastic agent (CHEBI:35610) |
| (+)-lyoniresinol (CHEBI:68168) has role metabolite (CHEBI:25212) |
| (+)-lyoniresinol (CHEBI:68168) is a dimethoxybenzene (CHEBI:51681) |
| (+)-lyoniresinol (CHEBI:68168) is a lignan (CHEBI:25036) |
| (+)-lyoniresinol (CHEBI:68168) is a polyphenol (CHEBI:26195) |
| (+)-lyoniresinol (CHEBI:68168) is a primary alcohol (CHEBI:15734) |
| (+)-lyoniresinol (CHEBI:68168) is a tetralins (CHEBI:36786) |
| Incoming Relation(s) |
| (+)-lyoniresinol 4,4'-bis-O-β-D-glucopyranoside (CHEBI:66605) has functional parent (+)-lyoniresinol (CHEBI:68168) |
| (+)-lyoniresinol-3-α-O-β-D-glucopyranoside (CHEBI:66606) has functional parent (+)-lyoniresinol (CHEBI:68168) |
| IUPAC Name |
|---|
| (6R,7R,8S)-8-(4-hydroxy-3,5-dimethoxyphenyl)-6,7-bis(hydroxymethyl)-1,3-dimethoxy-5,6,7,8-tetrahydronaphthalen-2-ol |
| Manual Xrefs | Databases |
|---|---|
| JP2010150152 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2191984 | Reaxys |
| Citations |
|---|