EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C34H48O18 |
| Net Charge | 0 |
| Average Mass | 744.740 |
| Monoisotopic Mass | 744.28406 |
| SMILES | COc1cc([C@H]2c3c(cc(OC)c(O[C@@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@H]4O)c3OC)C[C@@H](CO)[C@@H]2CO)cc(OC)c1O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C34H48O18/c1-45-17-7-14(8-18(46-2)30(17)51-33-28(43)26(41)24(39)20(11-37)49-33)22-16(10-36)15(9-35)5-13-6-19(47-3)31(32(48-4)23(13)22)52-34-29(44)27(42)25(40)21(12-38)50-34/h6-8,15-16,20-22,24-29,33-44H,5,9-12H2,1-4H3/t15-,16-,20+,21+,22+,24+,25+,26-,27-,28+,29+,33-,34-/m0/s1 |
| InChIKey | WDBFWRZVSDUFTE-AUWKFTQZSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Indigofera heterantha (ncbitaxon:198880) | whole plant (BTO:0001461) | PubMed (15744094) |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. lipoxygenase inhibitor A compound or agent that combines with lipoxygenase and thereby prevents its substrate-enzyme combination with arachidonic acid and the formation of the icosanoid products hydroxyicosatetraenoic acid and various leukotrienes. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (+)-lyoniresinol 4,4'-bis-O-β-D-glucopyranoside (CHEBI:66605) has functional parent (+)-lyoniresinol (CHEBI:68168) |
| (+)-lyoniresinol 4,4'-bis-O-β-D-glucopyranoside (CHEBI:66605) has role lipoxygenase inhibitor (CHEBI:35856) |
| (+)-lyoniresinol 4,4'-bis-O-β-D-glucopyranoside (CHEBI:66605) has role metabolite (CHEBI:25212) |
| (+)-lyoniresinol 4,4'-bis-O-β-D-glucopyranoside (CHEBI:66605) is a dimethoxybenzene (CHEBI:51681) |
| (+)-lyoniresinol 4,4'-bis-O-β-D-glucopyranoside (CHEBI:66605) is a lignan (CHEBI:25036) |
| (+)-lyoniresinol 4,4'-bis-O-β-D-glucopyranoside (CHEBI:66605) is a primary alcohol (CHEBI:15734) |
| (+)-lyoniresinol 4,4'-bis-O-β-D-glucopyranoside (CHEBI:66605) is a tetralins (CHEBI:36786) |
| (+)-lyoniresinol 4,4'-bis-O-β-D-glucopyranoside (CHEBI:66605) is a β-D-glucoside (CHEBI:22798) |
| IUPAC Name |
|---|
| 4-[(1S,2R,3R)-7-(β-D-glucopyranosyloxy)-2,3-bis(hydroxymethyl)-6,8-dimethoxy-1,2,3,4-tetrahydronaphthalen-1-yl]-2,6-dimethoxyphenyl β-D-glucopyranoside |
| Registry Numbers | Sources |
|---|---|
| Reaxys:10142896 | Reaxys |
| Citations |
|---|