EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H38O13 |
| Net Charge | 0 |
| Average Mass | 582.599 |
| Monoisotopic Mass | 582.23124 |
| SMILES | COc1cc([C@H]2c3c(cc(OC)c(O)c3OC)C[C@@H](CO)[C@@H]2CO[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)cc(OC)c1O |
| InChI | InChI=1S/C28H38O13/c1-36-16-7-13(8-17(37-2)22(16)31)20-15(11-40-28-26(35)25(34)23(32)19(10-30)41-28)14(9-29)5-12-6-18(38-3)24(33)27(39-4)21(12)20/h6-8,14-15,19-20,23,25-26,28-35H,5,9-11H2,1-4H3/t14-,15-,19+,20+,23+,25-,26+,28+/m0/s1 |
| InChIKey | PQQRNPDHSJDAGV-HQSXISOASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Lycium chinense (ncbitaxon:112883) | root (BTO:0001188) | PubMed (16212233) | Previous component: root bark; |
| Stemmadenia minima (IPNI:81813-1) | stem (BTO:0001300) | PubMed (17226467) | Previous component: stem bark; |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (+)-lyoniresinol-3-α-O-β-D-glucopyranoside (CHEBI:66606) has functional parent (+)-lyoniresinol (CHEBI:68168) |
| (+)-lyoniresinol-3-α-O-β-D-glucopyranoside (CHEBI:66606) has role antibacterial agent (CHEBI:33282) |
| (+)-lyoniresinol-3-α-O-β-D-glucopyranoside (CHEBI:66606) has role antifungal agent (CHEBI:35718) |
| (+)-lyoniresinol-3-α-O-β-D-glucopyranoside (CHEBI:66606) has role metabolite (CHEBI:25212) |
| (+)-lyoniresinol-3-α-O-β-D-glucopyranoside (CHEBI:66606) is a dimethoxybenzene (CHEBI:51681) |
| (+)-lyoniresinol-3-α-O-β-D-glucopyranoside (CHEBI:66606) is a lignan (CHEBI:25036) |
| (+)-lyoniresinol-3-α-O-β-D-glucopyranoside (CHEBI:66606) is a monosaccharide derivative (CHEBI:63367) |
| (+)-lyoniresinol-3-α-O-β-D-glucopyranoside (CHEBI:66606) is a polyphenol (CHEBI:26195) |
| (+)-lyoniresinol-3-α-O-β-D-glucopyranoside (CHEBI:66606) is a primary alcohol (CHEBI:15734) |
| (+)-lyoniresinol-3-α-O-β-D-glucopyranoside (CHEBI:66606) is a tetralins (CHEBI:36786) |
| (+)-lyoniresinol-3-α-O-β-D-glucopyranoside (CHEBI:66606) is a β-D-glucoside (CHEBI:22798) |
| IUPAC Name |
|---|
| [(1S,2R,3R)-7-hydroxy-1-(4-hydroxy-3,5-dimethoxyphenyl)-3-(hydroxymethyl)-6,8-dimethoxy-1,2,3,4-tetrahydronaphthalen-2-yl]methyl β-D-glucopyranoside |
| Synonyms | Source |
|---|---|
| (+)-lyoniresinol 9'-O-β-D-glucopyranoside | ChEBI |
| pteleifoside G | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0038922 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6168345 | Reaxys |
| Citations |
|---|