EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H30O16 |
| Net Charge | 0 |
| Average Mass | 610.521 |
| Monoisotopic Mass | 610.15338 |
| SMILES | C[C@@H]1O[C@@H](Oc2cc(O)c3c(=O)c(O[C@@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@H]4O)c(-c4ccc(O)c(O)c4)oc3c2)[C@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C27H30O16/c1-8-17(32)20(35)22(37)26(39-8)40-10-5-13(31)16-14(6-10)41-24(9-2-3-11(29)12(30)4-9)25(19(16)34)43-27-23(38)21(36)18(33)15(7-28)42-27/h2-6,8,15,17-18,20-23,26-33,35-38H,7H2,1H3/t8-,15+,17-,18+,20+,21-,22+,23+,26-,27-/m0/s1 |
| InChIKey | OTUCXMIQUNROBJ-JFNZIVIESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Delphinium staphisagria (ncbitaxon:104301) | aerial part (BTO:0001658) | PubMed (21466157) | 80% ethanolic extract of chopped fresh plant |
| Roles Classification |
|---|
| Biological Roles: | trypanocidal drug A drug used to treat or prevent infections caused by protozoal organisms belonging to the suborder Trypanosomatida. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | trypanocidal drug A drug used to treat or prevent infections caused by protozoal organisms belonging to the suborder Trypanosomatida. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| petiolaroside (CHEBI:67931) has functional parent α-L-rhamnopyranose (CHEBI:27907) |
| petiolaroside (CHEBI:67931) has role plant metabolite (CHEBI:76924) |
| petiolaroside (CHEBI:67931) has role trypanocidal drug (CHEBI:36335) |
| petiolaroside (CHEBI:67931) is a quercetin O-glucoside (CHEBI:64621) |
| petiolaroside (CHEBI:67931) is a trihydroxyflavone (CHEBI:27116) |
| petiolaroside (CHEBI:67931) is a β-D-glucoside (CHEBI:22798) |
| petiolaroside (CHEBI:67931) is conjugate acid of petiolaroside(1−) (CHEBI:144436) |
| Incoming Relation(s) |
| 2''-acetylpetiolaroside (CHEBI:67932) has functional parent petiolaroside (CHEBI:67931) |
| petiolaroside decaacetate (CHEBI:67933) has functional parent petiolaroside (CHEBI:67931) |
| petiolaroside(1−) (CHEBI:144436) is conjugate base of petiolaroside (CHEBI:67931) |
| IUPAC Name |
|---|
| 7-[(6-deoxy-α-L-mannopyranosyl)oxy]-2-(3,4-dihydroxyphenyl)-5-hydroxy-4-oxo-4H-chromen-3-yl β-D-glucopyranoside |
| Synonyms | Source |
|---|---|
| 7-((6-deoxy-α-L-mannopyranosyl)oxy)-2-(3,4-dihydroxyphenyl)-3-(β-D-glucopyranosyloxy)-5-hydroxy-4H-1-benzopyran-4-one | ChemIDplus |
| vincetoxicoside A | ChemIDplus |
| quercetin-3-O-β-D-glucopyranoside-7-O-α-L-rhamnopyranoside | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1339876 | Reaxys |
| CAS:18016-58-5 | ChemIDplus |
| Citations |
|---|