EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H32O17 |
| Net Charge | 0 |
| Average Mass | 652.558 |
| Monoisotopic Mass | 652.16395 |
| SMILES | CC(=O)O[C@H]1[C@H](Oc2c(-c3ccc(O)c(O)c3)oc3cc(O[C@@H]4O[C@@H](C)[C@H](O)[C@@H](O)[C@H]4O)cc(O)c3c2=O)O[C@H](CO)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C29H32O17/c1-9-19(35)22(38)24(40)28(41-9)43-12-6-15(34)18-16(7-12)44-25(11-3-4-13(32)14(33)5-11)26(21(18)37)46-29-27(42-10(2)31)23(39)20(36)17(8-30)45-29/h3-7,9,17,19-20,22-24,27-30,32-36,38-40H,8H2,1-2H3/t9-,17+,19-,20+,22+,23-,24+,27+,28-,29-/m0/s1 |
| InChIKey | RZRIJLLGEUPKNZ-BIENJXGCSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Delphinium staphisagria (ncbitaxon:104301) | aerial part (BTO:0001658) | PubMed (21466157) | 80% ethanolic extract of chopped fresh plant |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. trypanocidal drug A drug used to treat or prevent infections caused by protozoal organisms belonging to the suborder Trypanosomatida. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | trypanocidal drug A drug used to treat or prevent infections caused by protozoal organisms belonging to the suborder Trypanosomatida. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2''-acetylpetiolaroside (CHEBI:67932) has functional parent petiolaroside (CHEBI:67931) |
| 2''-acetylpetiolaroside (CHEBI:67932) has functional parent α-L-rhamnopyranose (CHEBI:27907) |
| 2''-acetylpetiolaroside (CHEBI:67932) has role metabolite (CHEBI:25212) |
| 2''-acetylpetiolaroside (CHEBI:67932) has role plant metabolite (CHEBI:76924) |
| 2''-acetylpetiolaroside (CHEBI:67932) has role trypanocidal drug (CHEBI:36335) |
| 2''-acetylpetiolaroside (CHEBI:67932) is a acetate ester (CHEBI:47622) |
| 2''-acetylpetiolaroside (CHEBI:67932) is a quercetin O-glucoside (CHEBI:64621) |
| 2''-acetylpetiolaroside (CHEBI:67932) is a trihydroxyflavone (CHEBI:27116) |
| 2''-acetylpetiolaroside (CHEBI:67932) is a β-D-glucoside (CHEBI:22798) |
| IUPAC Name |
|---|
| 7-[(6-deoxy-α-L-mannopyranosyl)oxy]-2-(3,4-dihydroxyphenyl)-5-hydroxy-4-oxo-4H-chromen-3-yl 2-O-acetyl-β-D-glucopyranoside |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21451711 | Reaxys |
| Citations |
|---|