EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H29O16 |
| Net Charge | -1 |
| Average Mass | 609.513 |
| Monoisotopic Mass | 609.14611 |
| SMILES | C[C@@H]1O[C@@H](Oc2cc([O-])c3c(=O)c(O[C@@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@H]4O)c(-c4ccc(O)c(O)c4)oc3c2)[C@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C27H30O16/c1-8-17(32)20(35)22(37)26(39-8)40-10-5-13(31)16-14(6-10)41-24(9-2-3-11(29)12(30)4-9)25(19(16)34)43-27-23(38)21(36)18(33)15(7-28)42-27/h2-6,8,15,17-18,20-23,26-33,35-38H,7H2,1H3/p-1/t8-,15+,17-,18+,20+,21-,22+,23+,26-,27-/m0/s1 |
| InChIKey | OTUCXMIQUNROBJ-JFNZIVIESA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| petiolaroside(1−) (CHEBI:144436) is a flavonoid oxoanion (CHEBI:60038) |
| petiolaroside(1−) (CHEBI:144436) is conjugate base of petiolaroside (CHEBI:67931) |
| Incoming Relation(s) |
| petiolaroside (CHEBI:67931) is conjugate acid of petiolaroside(1−) (CHEBI:144436) |
| UniProt Name | Source |
|---|---|
| quercetin 3-O-β-D-glucoside-7-O-α-L-rhamnoside | UniProt |