EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H14O5 |
| Net Charge | 0 |
| Average Mass | 214.217 |
| Monoisotopic Mass | 214.08412 |
| SMILES | COc1cc([C@H](O)[C@@H](O)CO)ccc1O |
| InChI | InChI=1S/C10H14O5/c1-15-9-4-6(2-3-7(9)12)10(14)8(13)5-11/h2-4,8,10-14H,5H2,1H3/t8-,10-/m0/s1 |
| InChIKey | LSKFUSLVUZISST-WPRPVWTQSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Sinocalamus affinis (IPNI:421970-1) | stem (BTO:0001300) | PubMed (21469695) | 95% Ethanolic extract of skin-removed, air-dried, powdered stems. |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (+)-(7S,8S)-guaiacylglycerol (CHEBI:67646) has role plant metabolite (CHEBI:76924) |
| (+)-(7S,8S)-guaiacylglycerol (CHEBI:67646) is a guaiacylglycerol (CHEBI:53663) |
| Incoming Relation(s) |
| (+)-(7S,8S)-guaiacylglycerol-β-vanillic acid ether (CHEBI:67649) has functional parent (+)-(7S,8S)-guaiacylglycerol (CHEBI:67646) |
| tricin 4'-O-(threo-β-guaiacylglyceryl) ether 7-O-β-D-glucopyranoside (CHEBI:131774) has functional parent (+)-(7S,8S)-guaiacylglycerol (CHEBI:67646) |
| IUPAC Name |
|---|
| (1S,2S)-1-(4-hydroxy-3-methoxyphenyl)propane-1,2,3-triol |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6768724 | Reaxys |
| Citations |
|---|