EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H20O8 |
| Net Charge | 0 |
| Average Mass | 364.350 |
| Monoisotopic Mass | 364.11582 |
| SMILES | COc1cc([C@H](O)[C@H](CO)Oc2ccc(C(=O)O)cc2OC)ccc1O |
| InChI | InChI=1S/C18H20O8/c1-24-14-7-10(3-5-12(14)20)17(21)16(9-19)26-13-6-4-11(18(22)23)8-15(13)25-2/h3-8,16-17,19-21H,9H2,1-2H3,(H,22,23)/t16-,17-/m0/s1 |
| InChIKey | UDFDXTXZIMXARD-IRXDYDNUSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Sinocalamus affinis (IPNI:421970-1) | stem (BTO:0001300) | PubMed (21469695) | 95% Ethanolic extract of skin-removed, air-dried, powdered stems. |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (+)-(7S,8S)-guaiacylglycerol-β-vanillic acid ether (CHEBI:67649) has functional parent (+)-(7S,8S)-guaiacylglycerol (CHEBI:67646) |
| (+)-(7S,8S)-guaiacylglycerol-β-vanillic acid ether (CHEBI:67649) has functional parent vanillic acid (CHEBI:30816) |
| (+)-(7S,8S)-guaiacylglycerol-β-vanillic acid ether (CHEBI:67649) is a aromatic ether (CHEBI:35618) |
| (+)-(7S,8S)-guaiacylglycerol-β-vanillic acid ether (CHEBI:67649) is a benzoic acids (CHEBI:22723) |
| (+)-(7S,8S)-guaiacylglycerol-β-vanillic acid ether (CHEBI:67649) is a guaiacols (CHEBI:134251) |
| (+)-(7S,8S)-guaiacylglycerol-β-vanillic acid ether (CHEBI:67649) is a triol (CHEBI:27136) |
| IUPAC Name |
|---|
| 4-{[(1S,2S)-1,3-dihydroxy-1-(4-hydroxy-3-methoxyphenyl)propan-2-yl]oxy}-3-methoxybenzoic acid |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21559767 | Reaxys |
| Citations |
|---|