EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C33H36O16 |
| Net Charge | 0 |
| Average Mass | 688.635 |
| Monoisotopic Mass | 688.20034 |
| SMILES | COc1cc([C@H](O)[C@H](CO)Oc2c(OC)cc(-c3cc(=O)c4c(O)cc(O[C@@H]5O[C@H](CO)[C@@H](O)[C@H](O)[C@H]5O)cc4o3)cc2OC)ccc1O |
| InChI | InChI=1S/C33H36O16/c1-43-21-6-14(4-5-17(21)36)28(39)25(12-34)48-32-23(44-2)7-15(8-24(32)45-3)20-11-19(38)27-18(37)9-16(10-22(27)47-20)46-33-31(42)30(41)29(40)26(13-35)49-33/h4-11,25-26,28-31,33-37,39-42H,12-13H2,1-3H3/t25-,26+,28-,29+,30-,31+,33+/m0/s1 |
| InChIKey | LAITWLZASKJXLZ-XWCWYVJLSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Oryza sativa (ncbitaxon:4530) | |||
| seed (BTO:0001226) | MetaboLights (MTBLS287) | ||
| seed (BTO:0001226) | PubMed (26860358) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tricin 4'-O-(threo-β-guaiacylglyceryl) ether 7-O-β-D-glucopyranoside (CHEBI:131774) has functional parent (+)-(7S,8S)-guaiacylglycerol (CHEBI:67646) |
| tricin 4'-O-(threo-β-guaiacylglyceryl) ether 7-O-β-D-glucopyranoside (CHEBI:131774) has functional parent 3',5'-di-O-methyltricetin (CHEBI:59979) |
| tricin 4'-O-(threo-β-guaiacylglyceryl) ether 7-O-β-D-glucopyranoside (CHEBI:131774) has role plant metabolite (CHEBI:76924) |
| tricin 4'-O-(threo-β-guaiacylglyceryl) ether 7-O-β-D-glucopyranoside (CHEBI:131774) is a dimethoxyflavone (CHEBI:23798) |
| tricin 4'-O-(threo-β-guaiacylglyceryl) ether 7-O-β-D-glucopyranoside (CHEBI:131774) is a glycosyloxyflavone (CHEBI:50018) |
| tricin 4'-O-(threo-β-guaiacylglyceryl) ether 7-O-β-D-glucopyranoside (CHEBI:131774) is a monohydroxyflavone (CHEBI:38687) |
| tricin 4'-O-(threo-β-guaiacylglyceryl) ether 7-O-β-D-glucopyranoside (CHEBI:131774) is a monosaccharide derivative (CHEBI:63367) |
| tricin 4'-O-(threo-β-guaiacylglyceryl) ether 7-O-β-D-glucopyranoside (CHEBI:131774) is a polyphenol (CHEBI:26195) |
| tricin 4'-O-(threo-β-guaiacylglyceryl) ether 7-O-β-D-glucopyranoside (CHEBI:131774) is a β-D-glucoside (CHEBI:22798) |
| IUPAC Name |
|---|
| 2-(4-{[(1S,2S)-1,3-dihydroxy-1-(4-hydroxy-3-methoxyphenyl)propan-2-yl]oxy}-3,5-dimethoxyphenyl)-5-hydroxy-4-oxo-4H-1-benzopyran-7-yl β-D-glucopyranoside |
| Citations |
|---|