EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H8O3 |
| Net Charge | 0 |
| Average Mass | 104.105 |
| Monoisotopic Mass | 104.04734 |
| SMILES | CCC(O)C(=O)O |
| InChI | InChI=1S/C4H8O3/c1-2-3(5)4(6)7/h3,5H,2H2,1H3,(H,6,7) |
| InChIKey | AFENDNXGAFYKQO-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Chlamydomonas reinhardtii (ncbitaxon:3055) | - | PubMed (25515814) | |
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). algal metabolite Any eukaryotic metabolite produced during a metabolic reaction in algae including unicellular organisms like chlorella and diatoms to multicellular organisms like giant kelps and brown algae. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-hydroxybutyric acid (CHEBI:1148) has functional parent butyric acid (CHEBI:30772) |
| 2-hydroxybutyric acid (CHEBI:1148) has role algal metabolite (CHEBI:84735) |
| 2-hydroxybutyric acid (CHEBI:1148) has role human metabolite (CHEBI:77746) |
| 2-hydroxybutyric acid (CHEBI:1148) is a 2-hydroxy monocarboxylic acid (CHEBI:49302) |
| 2-hydroxybutyric acid (CHEBI:1148) is a hydroxybutyric acid (CHEBI:24684) |
| 2-hydroxybutyric acid (CHEBI:1148) is conjugate acid of 2-hydroxybutyrate (CHEBI:64552) |
| Incoming Relation(s) |
| 2-hydroxybutanoyl-CoA (CHEBI:139303) has functional parent 2-hydroxybutyric acid (CHEBI:1148) |
| (R)-2-hydroxybutyric acid (CHEBI:50612) is a 2-hydroxybutyric acid (CHEBI:1148) |
| (S)-2-hydroxybutyric acid (CHEBI:50613) is a 2-hydroxybutyric acid (CHEBI:1148) |
| 2-hydroxybutyrate (CHEBI:64552) is conjugate base of 2-hydroxybutyric acid (CHEBI:1148) |
| IUPAC Name |
|---|
| 2-hydroxybutanoic acid |
| Synonyms | Source |
|---|---|
| 2-Hydroxybutanoic acid | KEGG COMPOUND |
| 2-Hydroxybutyric acid | KEGG COMPOUND |
| 2-Hydroxybutyric acid | ChEMBL |
| α-hydroxybutanoic acid | ChEBI |
| α-hydroxybutyric acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 2-Hydroxybutyric_acid | Wikipedia |
| C05984 | KEGG COMPOUND |
| HMDB0000008 | HMDB |
| LMFA01050004 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:878248 | Reaxys |
| CAS:600-15-7 | ChemIDplus |
| Citations |
|---|