EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H8O3 |
| Net Charge | 0 |
| Average Mass | 104.105 |
| Monoisotopic Mass | 104.04734 |
| SMILES | CC[C@@H](O)C(=O)O |
| InChI | InChI=1S/C4H8O3/c1-2-3(5)4(6)7/h3,5H,2H2,1H3,(H,6,7)/t3-/m1/s1 |
| InChIKey | AFENDNXGAFYKQO-GSVOUGTGSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). algal metabolite Any eukaryotic metabolite produced during a metabolic reaction in algae including unicellular organisms like chlorella and diatoms to multicellular organisms like giant kelps and brown algae. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (R)-2-hydroxybutyric acid (CHEBI:50612) is a 2-hydroxybutyric acid (CHEBI:1148) |
| (R)-2-hydroxybutyric acid (CHEBI:50612) is conjugate acid of (R)-2-hydroxybutyrate (CHEBI:232384) |
| (R)-2-hydroxybutyric acid (CHEBI:50612) is enantiomer of (S)-2-hydroxybutyric acid (CHEBI:50613) |
| Incoming Relation(s) |
| (R)-2-hydroxybutyrate (CHEBI:232384) is conjugate base of (R)-2-hydroxybutyric acid (CHEBI:50612) |
| (S)-2-hydroxybutyric acid (CHEBI:50613) is enantiomer of (R)-2-hydroxybutyric acid (CHEBI:50612) |
| IUPAC Name |
|---|
| (2R)-2-hydroxybutanoic acid |
| Synonyms | Source |
|---|---|
| (−)-2-hydroxybutanoic acid | ChEBI |
| (−)-2-hydroxybutyric acid | ChEBI |
| (2R)-2-hydroxybutyric acid | ChEBI |
| (R)-2-hydroxybutanoic acid | ChEBI |
| (R)-α-hydroxybutyric acid | ChEBI |
| D-2-hydroxybutanoic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| LMFA01050455 | LIPID MAPS |
| UCU | PDBeChem |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1720939 | Reaxys |
| CAS:20016-85-7 | ChEBI |
| Citations |
|---|