EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H7O3 |
| Net Charge | -1 |
| Average Mass | 103.097 |
| Monoisotopic Mass | 103.04007 |
| SMILES | CCC(O)C(=O)[O-] |
| InChI | InChI=1S/C4H8O3/c1-2-3(5)4(6)7/h3,5H,2H2,1H3,(H,6,7)/p-1 |
| InChIKey | AFENDNXGAFYKQO-UHFFFAOYSA-M |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | - | PubMed (17190852) | |
| Homo sapiens (ncbitaxon:9606) | - | PubMed (17190852) |
| Roles Classification |
|---|
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-hydroxybutyrate (CHEBI:64552) has functional parent butyrate (CHEBI:17968) |
| 2-hydroxybutyrate (CHEBI:64552) has role human metabolite (CHEBI:77746) |
| 2-hydroxybutyrate (CHEBI:64552) is a 2-hydroxybutyrates (CHEBI:133791) |
| 2-hydroxybutyrate (CHEBI:64552) is conjugate base of 2-hydroxybutyric acid (CHEBI:1148) |
| Incoming Relation(s) |
| (R)-2-hydroxybutyrate (CHEBI:232384) is a 2-hydroxybutyrate (CHEBI:64552) |
| (S)-2-hydroxybutyrate (CHEBI:73709) is a 2-hydroxybutyrate (CHEBI:64552) |
| 2-hydroxybutyric acid (CHEBI:1148) is conjugate acid of 2-hydroxybutyrate (CHEBI:64552) |
| Synonyms | Source |
|---|---|
| α-hydroxybutanoate | ChEBI |
| α-hydroxybutyrate | ChEBI |
| 2-hydroxybutanoate | ChEBI |
| UniProt Name | Source |
|---|---|
| 2-hydroxybutanoate | UniProt |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3661492 | Reaxys |
| Citations |
|---|