EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:50613 - (S)-2-hydroxybutyric acid
| Formula | C4H8O3 |
| Net Charge | 0 |
| Average Mass | 104.105 |
| Monoisotopic Mass | 104.04734 |
| SMILES | CC[C@H](O)C(=O)O |
| InChI | InChI=1S/C4H8O3/c1-2-3(5)4(6)7/h3,5H,2H2,1H3,(H,6,7)/t3-/m0/s1 |
| InChIKey | AFENDNXGAFYKQO-VKHMYHEASA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). algal metabolite Any eukaryotic metabolite produced during a metabolic reaction in algae including unicellular organisms like chlorella and diatoms to multicellular organisms like giant kelps and brown algae. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (S)-2-hydroxybutyric acid (CHEBI:50613) is a (2S)-2-hydroxy monocarboxylic acid (CHEBI:17375) |
| (S)-2-hydroxybutyric acid (CHEBI:50613) is a 2-hydroxybutyric acid (CHEBI:1148) |
| (S)-2-hydroxybutyric acid (CHEBI:50613) is conjugate acid of (S)-2-hydroxybutyrate (CHEBI:73709) |
| (S)-2-hydroxybutyric acid (CHEBI:50613) is enantiomer of (R)-2-hydroxybutyric acid (CHEBI:50612) |
| Incoming Relation(s) |
| (S)-2-hydroxybutyrate (CHEBI:73709) is conjugate base of (S)-2-hydroxybutyric acid (CHEBI:50613) |
| (R)-2-hydroxybutyric acid (CHEBI:50612) is enantiomer of (S)-2-hydroxybutyric acid (CHEBI:50613) |
| IUPAC Name |
|---|
| (2S)-2-hydroxybutanoic acid |
| Synonyms | Source |
|---|---|
| L-2-hydroxybutyric acid | MetaCyc |
| L-2-hydroxybutanoic acid | ChEBI |
| (S)-2-hydroxybutanoic acid | ChEBI |
| L-α-hydroxybutanoic acid | ChEBI |
| L-α-hydroxybutyric acid | ChEBI |
| 2-Hydroxybutyric acid | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| LMFA01050342 | LIPID MAPS |
| CPD-3564 | MetaCyc |
| C05984 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1720940 | Reaxys |
| Citations |
|---|