EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H48O3 |
| Net Charge | 0 |
| Average Mass | 456.711 |
| Monoisotopic Mass | 456.36035 |
| SMILES | [H][C@@]12CCC(=C)[C@H](CC[C@H]3C(C)=CC[C@@H](C(=C)C)[C@]3(C)CCC(=O)O)[C@@]1(C)CC[C@H](O)C2(C)C |
| InChI | InChI=1S/C30H48O3/c1-19(2)22-11-9-20(3)23(29(22,7)18-16-27(32)33)12-13-24-21(4)10-14-25-28(5,6)26(31)15-17-30(24,25)8/h9,22-26,31H,1,4,10-18H2,2-3,5-8H3,(H,32,33)/t22-,23-,24-,25-,26-,29-,30+/m0/s1 |
| InChIKey | VEQOUQWWEZDGIO-PIGJLUHJSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Lansium domesticum (ncbitaxon:201017) | twig (BTO:0001411) | PubMed (21401117) | 95% ethanolic extract of air-dried and powdered twigs |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lansiolic acid (CHEBI:67483) has role plant metabolite (CHEBI:76924) |
| lansiolic acid (CHEBI:67483) is a hydroxy monocarboxylic acid (CHEBI:35868) |
| lansiolic acid (CHEBI:67483) is a triterpenoid (CHEBI:36615) |
| Incoming Relation(s) |
| ethyl lansiolate (CHEBI:67481) has functional parent lansiolic acid (CHEBI:67483) |
| methyl lansiolate (CHEBI:67484) has functional parent lansiolic acid (CHEBI:67483) |
| IUPAC Name |
|---|
| 3-[(1S,2S,6S)-2-{2-[(1S,4aR,6S,8aR)-6-hydroxy-5,5,8a-trimethyl-2-methylidenedecahydronaphthalen-1-yl]ethyl}-1,3-dimethyl-6-(prop-1-en-2-yl)cyclohex-3-en-1-yl]propanoic acid |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4723365 | Reaxys |
| Citations |
|---|