EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C31H50O3 |
| Net Charge | 0 |
| Average Mass | 470.738 |
| Monoisotopic Mass | 470.37600 |
| SMILES | [H][C@@]12CCC(=C)[C@H](CC[C@H]3C(C)=CC[C@@H](C(=C)C)[C@]3(C)CCC(=O)OC)[C@@]1(C)CC[C@H](O)C2(C)C |
| InChI | InChI=1S/C31H50O3/c1-20(2)23-12-10-21(3)24(30(23,7)19-17-28(33)34-9)13-14-25-22(4)11-15-26-29(5,6)27(32)16-18-31(25,26)8/h10,23-27,32H,1,4,11-19H2,2-3,5-9H3/t23-,24-,25-,26-,27-,30-,31+/m0/s1 |
| InChIKey | UCRMFRXIRGKEPT-NGVCODNXSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Lansium domesticum (ncbitaxon:201017) | twig (BTO:0001411) | PubMed (21401117) | 95% ethanolic extract of air-dried and powdered twigs |
| Roles Classification |
|---|
| Biological Roles: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| methyl lansiolate (CHEBI:67484) has functional parent lansiolic acid (CHEBI:67483) |
| methyl lansiolate (CHEBI:67484) has role antibacterial agent (CHEBI:33282) |
| methyl lansiolate (CHEBI:67484) has role plant metabolite (CHEBI:76924) |
| methyl lansiolate (CHEBI:67484) is a methyl ester (CHEBI:25248) |
| methyl lansiolate (CHEBI:67484) is a secondary alcohol (CHEBI:35681) |
| methyl lansiolate (CHEBI:67484) is a triterpenoid (CHEBI:36615) |
| IUPAC Name |
|---|
| methyl 3-[(1S,2S,6S)-2-{2-[(1S,4aR,6S,8aR)-6-hydroxy-5,5,8a-trimethyl-2-methylidenedecahydronaphthalen-1-yl]ethyl}-1,3-dimethyl-6-(prop-1-en-2-yl)cyclohex-3-en-1-yl]propanoate |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4724977 | Reaxys |
| Citations |
|---|