EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H52O3 |
| Net Charge | 0 |
| Average Mass | 484.765 |
| Monoisotopic Mass | 484.39165 |
| SMILES | [H][C@@]12CCC(=C)[C@H](CC[C@H]3C(C)=CC[C@@H](C(=C)C)[C@]3(C)CCC(=O)OCC)[C@@]1(C)CC[C@H](O)C2(C)C |
| InChI | InChI=1S/C32H52O3/c1-10-35-29(34)18-20-31(8)24(21(2)3)13-11-22(4)25(31)14-15-26-23(5)12-16-27-30(6,7)28(33)17-19-32(26,27)9/h11,24-28,33H,2,5,10,12-20H2,1,3-4,6-9H3/t24-,25-,26-,27-,28-,31-,32+/m0/s1 |
| InChIKey | MBFTWDFKACXAAV-XXYMEPQGSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Lansium domesticum (ncbitaxon:201017) | twig (BTO:0001411) | PubMed (21401117) | 95% ethanolic extract of air-dried and powdered twigs |
| Roles Classification |
|---|
| Biological Roles: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ethyl lansiolate (CHEBI:67481) has functional parent lansiolic acid (CHEBI:67483) |
| ethyl lansiolate (CHEBI:67481) has role antibacterial agent (CHEBI:33282) |
| ethyl lansiolate (CHEBI:67481) has role metabolite (CHEBI:25212) |
| ethyl lansiolate (CHEBI:67481) has role plant metabolite (CHEBI:76924) |
| ethyl lansiolate (CHEBI:67481) is a ethyl ester (CHEBI:23990) |
| ethyl lansiolate (CHEBI:67481) is a secondary alcohol (CHEBI:35681) |
| ethyl lansiolate (CHEBI:67481) is a triterpenoid (CHEBI:36615) |
| IUPAC Name |
|---|
| ethyl 3-[(1S,2S,6S)-2-{2-[(1S,4aR,6S,8aR)-6-hydroxy-5,5,8a-trimethyl-2-methylidenedecahydronaphthalen-1-yl]ethyl}-1,3-dimethyl-6-(prop-1-en-2-yl)cyclohex-3-en-1-yl]propanoate |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21534275 | Reaxys |
| Citations |
|---|