EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C34H44O9 |
| Net Charge | 0 |
| Average Mass | 596.717 |
| Monoisotopic Mass | 596.29853 |
| SMILES | [H][C@]12OC[C@]3(C)[C@H](OC(C)=O)C[C@H](OC(=O)/C(C)=C/C)[C@](C)([C@@H](CC(=O)OC)[C@]4(C)C5=C(C)[C@H](c6ccoc6)C[C@@]5([H])O[C@]14[H])[C@@]23[H] |
| InChI | InChI=1S/C34H44O9/c1-9-17(2)31(37)43-25-14-24(41-19(4)35)32(5)16-40-28-29(32)33(25,6)23(13-26(36)38-8)34(7)27-18(3)21(20-10-11-39-15-20)12-22(27)42-30(28)34/h9-11,15,21-25,28-30H,12-14,16H2,1-8H3/b17-9+/t21-,22-,23-,24-,25+,28-,29+,30-,32-,33+,34-/m1/s1 |
| InChIKey | CJHBVBNPNXOWBA-REXVOHEDSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Azadirachta indica (ncbitaxon:124943) | seed (BTO:0001226) | PubMed (21381696) | n-Hexane extract of seeds |
| Roles Classification |
|---|
| Biological Roles: | insect growth regulator A growth regulator that inhibits the life cycle of an insect. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Applications: | antifeedant A substance that prevents pests from feeding. insect growth regulator A growth regulator that inhibits the life cycle of an insect. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| salannin (CHEBI:67309) has functional parent tiglic acid (CHEBI:9592) |
| salannin (CHEBI:67309) has role antifeedant (CHEBI:22583) |
| salannin (CHEBI:67309) has role insect growth regulator (CHEBI:24851) |
| salannin (CHEBI:67309) has role plant metabolite (CHEBI:76924) |
| salannin (CHEBI:67309) is a acetate ester (CHEBI:47622) |
| salannin (CHEBI:67309) is a furans (CHEBI:24129) |
| salannin (CHEBI:67309) is a limonoid (CHEBI:39434) |
| salannin (CHEBI:67309) is a methyl ester (CHEBI:25248) |
| salannin (CHEBI:67309) is a organic heteropentacyclic compound (CHEBI:38164) |
| Incoming Relation(s) |
| 17-defurano-17-oxosalannin (CHEBI:67312) has functional parent salannin (CHEBI:67309) |
| 2',3'-dihydrosalannin (CHEBI:67310) has functional parent salannin (CHEBI:67309) |
| 3-deacetylsalannin (CHEBI:67311) has functional parent salannin (CHEBI:67309) |
| IUPAC Name |
|---|
| (2aR,3R,5S,5aR,6R,6aR,8R,9aR,10aS,10bR,10cR)-3-(acetyloxy)-8-(furan-3-yl)-6-(2-methoxy-2-oxoethyl)-2a,5a,6a,7-tetramethyl-2a,4,5,5a,6,6a,8,9,9a,10a,10b,10c-dodecahydro-2H,3H-cyclopenta[d]naphtho[2,3-b:1,8-b'c']difuran-5-yl (2E)-2-methylbut-2-enoate |
| Synonym | Source |
|---|---|
| Azadriactin | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C08780 | KEGG COMPOUND |
| JP2004277393 | Patent |
| C00003728 | KNApSAcK |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5326288 | Reaxys |
| CAS:992-20-1 | KEGG COMPOUND |
| CAS:992-20-1 | ChemIDplus |
| Citations |
|---|