EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H40O9 |
| Net Charge | 0 |
| Average Mass | 544.641 |
| Monoisotopic Mass | 544.26723 |
| SMILES | [H][C@]12OC[C@]3(C)[C@H](OC(C)=O)C[C@H](OC(=O)/C(C)=C/C)[C@](C)([C@@H](CC(=O)OC)[C@]4(C)C5=C(C)C(=O)C[C@@]5([H])O[C@]14[H])[C@@]23[H] |
| InChI | InChI=1S/C30H40O9/c1-9-14(2)27(34)39-21-12-20(37-16(4)31)28(5)13-36-24-25(28)29(21,6)19(11-22(33)35-8)30(7)23-15(3)17(32)10-18(23)38-26(24)30/h9,18-21,24-26H,10-13H2,1-8H3/b14-9+/t18-,19-,20-,21+,24-,25+,26-,28-,29+,30-/m1/s1 |
| InChIKey | LGQIDAUSKKGKHE-RYKSROFQSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Azadirachta indica (ncbitaxon:124943) | seed (BTO:0001226) | PubMed (21381696) | n-Hexane extract of seeds |
| Roles Classification |
|---|
| Application: | anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 17-defurano-17-oxosalannin (CHEBI:67312) has functional parent salannin (CHEBI:67309) |
| 17-defurano-17-oxosalannin (CHEBI:67312) has functional parent tiglic acid (CHEBI:9592) |
| 17-defurano-17-oxosalannin (CHEBI:67312) has role anti-inflammatory agent (CHEBI:67079) |
| 17-defurano-17-oxosalannin (CHEBI:67312) is a acetate ester (CHEBI:47622) |
| 17-defurano-17-oxosalannin (CHEBI:67312) is a cyclic terpene ketone (CHEBI:36130) |
| 17-defurano-17-oxosalannin (CHEBI:67312) is a enone (CHEBI:51689) |
| 17-defurano-17-oxosalannin (CHEBI:67312) is a limonoid (CHEBI:39434) |
| 17-defurano-17-oxosalannin (CHEBI:67312) is a methyl ester (CHEBI:25248) |
| 17-defurano-17-oxosalannin (CHEBI:67312) is a organic heteropentacyclic compound (CHEBI:38164) |
| IUPAC Name |
|---|
| (2aR,3R,5S,5aR,6R,6aR,9aR,10aS,10bR,10cR)-3-(acetyloxy)-6-(2-methoxy-2-oxoethyl)-2a,5a,6a,7-tetramethyl-8-oxo-2a,4,5,5a,6,6a,8,9,9a,10a,10b,10c-dodecahydro-2H,3H-cyclopenta[d]naphtho[2,3-b:1,8-b'c']difuran-5-yl (2E)-2-methylbut-2-enoate |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21448582 | Reaxys |
| Citations |
|---|