EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H42O8 |
| Net Charge | 0 |
| Average Mass | 554.680 |
| Monoisotopic Mass | 554.28797 |
| SMILES | [H][C@]12OC[C@]3(C)[C@H](O)C[C@H](OC(=O)/C(C)=C/C)[C@](C)([C@@H](CC(=O)OC)[C@]4(C)C5=C(C)[C@H](c6ccoc6)C[C@@]5([H])O[C@]14[H])[C@@]23[H] |
| InChI | InChI=1S/C32H42O8/c1-8-16(2)29(35)40-23-13-22(33)30(4)15-38-26-27(30)31(23,5)21(12-24(34)36-7)32(6)25-17(3)19(18-9-10-37-14-18)11-20(25)39-28(26)32/h8-10,14,19-23,26-28,33H,11-13,15H2,1-7H3/b16-8+/t19-,20-,21-,22-,23+,26-,27+,28-,30-,31+,32-/m1/s1 |
| InChIKey | MJNRBOGIPLCVIM-LJEOTECVSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Azadirachta indica (ncbitaxon:124943) | seed (BTO:0001226) | PubMed (21381696) | n-Hexane extract of seeds |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-deacetylsalannin (CHEBI:67311) has functional parent salannin (CHEBI:67309) |
| 3-deacetylsalannin (CHEBI:67311) has functional parent tiglic acid (CHEBI:9592) |
| 3-deacetylsalannin (CHEBI:67311) has role anti-inflammatory agent (CHEBI:67079) |
| 3-deacetylsalannin (CHEBI:67311) has role plant metabolite (CHEBI:76924) |
| 3-deacetylsalannin (CHEBI:67311) is a furans (CHEBI:24129) |
| 3-deacetylsalannin (CHEBI:67311) is a limonoid (CHEBI:39434) |
| 3-deacetylsalannin (CHEBI:67311) is a methyl ester (CHEBI:25248) |
| 3-deacetylsalannin (CHEBI:67311) is a organic heteropentacyclic compound (CHEBI:38164) |
| IUPAC Name |
|---|
| (2aR,3R,5S,5aR,6R,6aR,8R,9aR,10aS,10bR,10cR)-8-(furan-3-yl)-3-hydroxy-6-(2-methoxy-2-oxoethyl)-2a,5a,6a,7-tetramethyl-2a,4,5,5a,6,6a,8,9,9a,10a,10b,10c-dodecahydro-2H,3H-cyclopenta[d]naphtho[2,3-b:1,8-b'c']difuran-5-yl (2E)-2-methylbut-2-enoate |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7675507 | Reaxys |
| CAS:1110-56-1 | ChemIDplus |
| Citations |
|---|