EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H34O5 |
| Net Charge | 0 |
| Average Mass | 450.575 |
| Monoisotopic Mass | 450.24062 |
| SMILES | [H][C@]12CC[C@]3(C)C(=CC(=O)[C@@]3([H])c3ccoc3)[C@]1(C)[C@H](OC(C)=O)C[C@@]1([H])C(C)(C)C(=O)C=C[C@]21C |
| InChI | InChI=1S/C28H34O5/c1-16(29)33-23-14-20-25(2,3)22(31)8-11-26(20,4)19-7-10-27(5)21(28(19,23)6)13-18(30)24(27)17-9-12-32-15-17/h8-9,11-13,15,19-20,23-24H,7,10,14H2,1-6H3/t19-,20+,23-,24-,26-,27-,28-/m1/s1 |
| InChIKey | KWAMDQVQFVBEAU-HMWIRDDCSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Azadirachta indica (ncbitaxon:124943) | seed (BTO:0001226) | PubMed (21381696) | Defatted MeOH extract of seeds |
| Roles Classification |
|---|
| Biological Roles: | antimycobacterial drug A drug used to treat or prevent infections caused by Mycobacteria, a genus of actinobacteria. Aerobic and nonmotile, members of the genus include the pathogens responsible for causing tuberculosis and leprosy. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Applications: | antimycobacterial drug A drug used to treat or prevent infections caused by Mycobacteria, a genus of actinobacteria. Aerobic and nonmotile, members of the genus include the pathogens responsible for causing tuberculosis and leprosy. anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| azadiradione (CHEBI:67280) has role anti-inflammatory agent (CHEBI:67079) |
| azadiradione (CHEBI:67280) has role antimycobacterial drug (CHEBI:64912) |
| azadiradione (CHEBI:67280) has role plant metabolite (CHEBI:76924) |
| azadiradione (CHEBI:67280) is a acetate ester (CHEBI:47622) |
| azadiradione (CHEBI:67280) is a cyclic terpene ketone (CHEBI:36130) |
| azadiradione (CHEBI:67280) is a furans (CHEBI:24129) |
| azadiradione (CHEBI:67280) is a limonoid (CHEBI:39434) |
| azadiradione (CHEBI:67280) is a tetracyclic triterpenoid (CHEBI:26893) |
| Incoming Relation(s) |
| 15-hydroxyazadiradione (CHEBI:67283) has functional parent azadiradione (CHEBI:67280) |
| 17-hydroxyazadiradione (CHEBI:67284) has functional parent azadiradione (CHEBI:67280) |
| desfuranoazadiradione (CHEBI:67292) has functional parent azadiradione (CHEBI:67280) |
| epoxyazadiradione (CHEBI:67285) has functional parent azadiradione (CHEBI:67280) |
| IUPAC Name |
|---|
| (5α,7α,13α,17α)-17-(furan-3-yl)-4,4,8-trimethyl-3,16-dioxoandrosta-1,14-dien-7-yl acetate |
| Synonym | Source |
|---|---|
| 24-Nor-5alpha,13alpha,17alpha-chola-1,14,20,22-tetraene-3,16-dione, 21,23-epoxy-7alpha-hydroxy-4,4,8-trimethyl-,acetate | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5858436 | Reaxys |
| CAS:26241-51-0 | ChemIDplus |
| Citations |
|---|