EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H34O6 |
| Net Charge | 0 |
| Average Mass | 466.574 |
| Monoisotopic Mass | 466.23554 |
| SMILES | [H][C@]12CC[C@]3(C)C(=CC(=O)[C@@]3(O)c3ccoc3)[C@]1(C)[C@H](OC(C)=O)C[C@@]1([H])C(C)(C)C(=O)C=C[C@]21C |
| InChI | InChI=1S/C28H34O6/c1-16(29)34-23-14-19-24(2,3)21(30)8-10-25(19,4)18-7-11-26(5)20(27(18,23)6)13-22(31)28(26,32)17-9-12-33-15-17/h8-10,12-13,15,18-19,23,32H,7,11,14H2,1-6H3/t18-,19+,23-,25-,26-,27-,28+/m1/s1 |
| InChIKey | QXKHBVSTPRHRQV-CWUDDJIGSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Azadirachta indica (ncbitaxon:124943) | seed (BTO:0001226) | PubMed (21381696) | Defatted MeOH extract of seeds |
| Roles Classification |
|---|
| Biological Roles: | enzyme inhibitor A compound or agent that combines with an enzyme in such a manner as to prevent the normal substrate-enzyme combination and the catalytic reaction. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 17-hydroxyazadiradione (CHEBI:67284) has functional parent azadiradione (CHEBI:67280) |
| 17-hydroxyazadiradione (CHEBI:67284) has role enzyme inhibitor (CHEBI:23924) |
| 17-hydroxyazadiradione (CHEBI:67284) has role metabolite (CHEBI:25212) |
| 17-hydroxyazadiradione (CHEBI:67284) has role plant metabolite (CHEBI:76924) |
| 17-hydroxyazadiradione (CHEBI:67284) is a acetate ester (CHEBI:47622) |
| 17-hydroxyazadiradione (CHEBI:67284) is a cyclic terpene ketone (CHEBI:36130) |
| 17-hydroxyazadiradione (CHEBI:67284) is a furans (CHEBI:24129) |
| 17-hydroxyazadiradione (CHEBI:67284) is a limonoid (CHEBI:39434) |
| 17-hydroxyazadiradione (CHEBI:67284) is a tertiary alcohol (CHEBI:26878) |
| 17-hydroxyazadiradione (CHEBI:67284) is a tertiary α-hydroxy ketone (CHEBI:139592) |
| 17-hydroxyazadiradione (CHEBI:67284) is a tetracyclic triterpenoid (CHEBI:26893) |
| IUPAC Name |
|---|
| (5α,7α,13α,17β)-17-(furan-3-yl)-17-hydroxy-4,4,8-trimethyl-3,16-dioxoandrosta-1,14-dien-7-yl acetate |
| Synonym | Source |
|---|---|
| 17β-hydroxyazadiradione | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5839095 | Reaxys |
| Citations |
|---|