EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H34O6 |
| Net Charge | 0 |
| Average Mass | 466.574 |
| Monoisotopic Mass | 466.23554 |
| SMILES | [H][C@]12CC[C@]3(C)C(=C(O)C(=O)[C@@]3([H])c3ccoc3)[C@]1(C)[C@H](OC(C)=O)C[C@@]1([H])C(C)(C)C(=O)C=C[C@]21C |
| InChI | InChI=1S/C28H34O6/c1-15(29)34-20-13-18-25(2,3)19(30)8-11-26(18,4)17-7-10-27(5)21(16-9-12-33-14-16)22(31)23(32)24(27)28(17,20)6/h8-9,11-12,14,17-18,20-21,32H,7,10,13H2,1-6H3/t17-,18+,20-,21-,26-,27+,28+/m1/s1 |
| InChIKey | LZENOAGERLXZPK-RRVWWXAYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Azadirachta indica (ncbitaxon:124943) | seed (BTO:0001226) | PubMed (21381696) | Defatted MeOH extract of seeds |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 15-hydroxyazadiradione (CHEBI:67283) has functional parent azadiradione (CHEBI:67280) |
| 15-hydroxyazadiradione (CHEBI:67283) has role plant metabolite (CHEBI:76924) |
| 15-hydroxyazadiradione (CHEBI:67283) is a acetate ester (CHEBI:47622) |
| 15-hydroxyazadiradione (CHEBI:67283) is a cyclic terpene ketone (CHEBI:36130) |
| 15-hydroxyazadiradione (CHEBI:67283) is a enol (CHEBI:33823) |
| 15-hydroxyazadiradione (CHEBI:67283) is a furans (CHEBI:24129) |
| 15-hydroxyazadiradione (CHEBI:67283) is a limonoid (CHEBI:39434) |
| 15-hydroxyazadiradione (CHEBI:67283) is a tetracyclic triterpenoid (CHEBI:26893) |
| IUPAC Name |
|---|
| (5α,7α,13α,17α)-17-(furan-3-yl)-15-hydroxy-4,4,8-trimethyl-3,16-dioxoandrosta-1,14-dien-7-yl acetate |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21448579 | Reaxys |
| Citations |
|---|