EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H22O6 |
| Net Charge | 0 |
| Average Mass | 370.401 |
| Monoisotopic Mass | 370.14164 |
| SMILES | COc1cc(/C=C/C(=O)CC(=O)CCc2ccc(O)c(OC)c2)ccc1O |
| InChI | InChI=1S/C21H22O6/c1-26-20-11-14(5-9-18(20)24)3-7-16(22)13-17(23)8-4-15-6-10-19(25)21(12-15)27-2/h3,5-7,9-12,24-25H,4,8,13H2,1-2H3/b7-3+ |
| InChIKey | MUYJSOCNDLUHPJ-XVNBXDOJSA-N |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dihydrocurcumin (CHEBI:67262) has functional parent curcumin (CHEBI:3962) |
| dihydrocurcumin (CHEBI:67262) is a 1,7-bis(4-hydroxy-3-methoxyphenyl)hept-1-ene-3,5-dione (CHEBI:176657) |
| IUPAC Name |
|---|
| (1E)-1,7-bis(4-hydroxy-3-methoxyphenyl)hept-1-ene-3,5-dione |
| UniProt Name | Source |
|---|---|
| dihydrocurcumin | UniProt |
| Manual Xrefs | Databases |
|---|---|
| 8604661 | ChemSpider |
| CPD-13314 | MetaCyc |
| FDB008164 | FooDB |
| HMDB0031552 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5631032 | Reaxys |
| CAS:76474-56-1 | ChemIDplus |
| Citations |
|---|