EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:176657 - 1,7-bis(4-hydroxy-3-methoxyphenyl)hept-1-ene-3,5-dione
| Formula | C21H22O6 |
| Net Charge | 0 |
| Average Mass | 370.401 |
| Monoisotopic Mass | 370.14164 |
| SMILES | [H]C(C(=O)CC(=O)CCc1ccc(O)c(OC)c1)=C([H])c1ccc(O)c(OC)c1 |
| InChI | InChI=1S/C21H22O6/c1-26-20-11-14(5-9-18(20)24)3-7-16(22)13-17(23)8-4-15-6-10-19(25)21(12-15)27-2/h3,5-7,9-12,24-25H,4,8,13H2,1-2H3 |
| InChIKey | MUYJSOCNDLUHPJ-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Curcuma aromatica (ncbitaxon:136209) | rhizome (BTO:0001181) | MetaboLights (MTBLS2790) | |
| Curcuma longa (ncbitaxon:136217) | rhizome (BTO:0001181) | MetaboLights (MTBLS2790) |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1,7-bis(4-hydroxy-3-methoxyphenyl)hept-1-ene-3,5-dione (CHEBI:176657) has role plant metabolite (CHEBI:76924) |
| 1,7-bis(4-hydroxy-3-methoxyphenyl)hept-1-ene-3,5-dione (CHEBI:176657) is a diarylheptanoid (CHEBI:78802) |
| 1,7-bis(4-hydroxy-3-methoxyphenyl)hept-1-ene-3,5-dione (CHEBI:176657) is a enone (CHEBI:51689) |
| 1,7-bis(4-hydroxy-3-methoxyphenyl)hept-1-ene-3,5-dione (CHEBI:176657) is a monomethoxybenzene (CHEBI:25235) |
| 1,7-bis(4-hydroxy-3-methoxyphenyl)hept-1-ene-3,5-dione (CHEBI:176657) is a polyphenol (CHEBI:26195) |
| 1,7-bis(4-hydroxy-3-methoxyphenyl)hept-1-ene-3,5-dione (CHEBI:176657) is a β-diketone (CHEBI:67265) |
| Incoming Relation(s) |
| dihydrocurcumin (CHEBI:67262) is a 1,7-bis(4-hydroxy-3-methoxyphenyl)hept-1-ene-3,5-dione (CHEBI:176657) |
| IUPAC Name |
|---|
| 1,7-bis(4-hydroxy-3-methoxyphenyl)hept-1-ene-3,5-dione |
| Synonym | Source |
|---|---|
| 1-heptene-3,5-dione, 1,7-bis(4-hydroxy-3-methoxyphenyl)- | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 74854176 | ChemSpider |
| Citations |
|---|