EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H28N3O7 |
| Net Charge | +3 |
| Average Mass | 326.370 |
| Monoisotopic Mass | 326.19108 |
| SMILES | [NH3+]C[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](O)[C@H]([NH3+])C[C@@H]2[NH3+])[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C12H25N3O7/c13-2-5-7(17)8(18)10(20)12(21-5)22-11-4(15)1-3(14)6(16)9(11)19/h3-12,16-20H,1-2,13-15H2/p+3/t3-,4+,5-,6+,7-,8+,9-,10-,11-,12-/m1/s1 |
| InChIKey | AWRLKTYNEGEURZ-JCLMPDJQSA-Q |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2'-deamino-2'-hydroxyneamine(3+) (CHEBI:67213) is a ammonium ion derivative (CHEBI:35274) |
| 2'-deamino-2'-hydroxyneamine(3+) (CHEBI:67213) is a organic cation (CHEBI:25697) |
| 2'-deamino-2'-hydroxyneamine(3+) (CHEBI:67213) is conjugate acid of 2'-deamino-2'-hydroxyneamine (CHEBI:67223) |
| Incoming Relation(s) |
| 2'-deamino-2'-hydroxyneamine (CHEBI:67223) is conjugate base of 2'-deamino-2'-hydroxyneamine(3+) (CHEBI:67213) |
| IUPAC Name |
|---|
| (1R,2R,3S,4R,6S)-4,6-diazaniumyl-2,3-dihydroxycyclohexyl 6-azaniumyl-6-deoxy-α-D-glucopyranoside |
| Synonym | Source |
|---|---|
| (1R,2R,3S,4R,6S)-4,6-diammonio-2,3-dihydroxycyclohexyl 6-ammonio-6-deoxy-α-D-glucopyranoside | IUPAC |
| UniProt Name | Source |
|---|---|
| 2'-deamino-2'-hydroxyneamine | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-14128 | MetaCyc |
| Citations |
|---|