EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H25N2O2S |
| Net Charge | +1 |
| Average Mass | 357.499 |
| Monoisotopic Mass | 357.16313 |
| SMILES | CC[NH+](CC)CCNc1ccc(CO)c2sc3ccccc3c(=O)c12 |
| InChI | InChI=1S/C20H24N2O2S/c1-3-22(4-2)12-11-21-16-10-9-14(13-23)20-18(16)19(24)15-7-5-6-8-17(15)25-20/h5-10,21,23H,3-4,11-13H2,1-2H3/p+1 |
| InChIKey | MFZWMTSUNYWVBU-UHFFFAOYSA-O |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| hycanthone(1+) (CHEBI:67141) is a ammonium ion derivative (CHEBI:35274) |
| hycanthone(1+) (CHEBI:67141) is conjugate acid of hycanthone (CHEBI:52768) |
| Incoming Relation(s) |
| hycanthone mesylate (CHEBI:24624) has part hycanthone(1+) (CHEBI:67141) |
| hycanthone (CHEBI:52768) is conjugate base of hycanthone(1+) (CHEBI:67141) |
| IUPAC Name |
|---|
| N,N-diethyl-2-{[4-(hydroxymethyl)-10-oxo-10H-dibenzo[b,e]thiopyran-1-yl]amino}ethanaminium |
| Registry Numbers | Sources |
|---|---|
| Reaxys:19574704 | Reaxys |