EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H24N2O2S.CH4O3S |
| Net Charge | 0 |
| Average Mass | 452.598 |
| Monoisotopic Mass | 452.14396 |
| SMILES | CCN(CC)CCNc1ccc(CO)c2sc3ccccc3c(=O)c12.CS(=O)(=O)O |
| InChI | InChI=1S/C20H24N2O2S.CH4O3S/c1-3-22(4-2)12-11-21-16-10-9-14(13-23)20-18(16)19(24)15-7-5-6-8-17(15)25-20;1-5(2,3)4/h5-10,21,23H,3-4,11-13H2,1-2H3;1H3,(H,2,3,4) |
| InChIKey | LOEQGPPJCCUXEJ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | alkylating agent Highly reactive chemical that introduces alkyl radicals into biologically active molecules and thereby prevents their proper functioning. It could be used as an antineoplastic agent, but it might be very toxic, with carcinogenic, mutagenic, teratogenic, and immunosuppressant actions. It could also be used as a component of poison gases. mutagen An agent that increases the frequency of mutations above the normal background level, usually by interacting directly with DNA and causing it damage, including base substitution. |
| Application: | schistosomicide drug Drugs that used to treat infestations by flukes (trematodes) of the genus Schistosoma. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| hycanthone mesylate (CHEBI:24624) has part hycanthone(1+) (CHEBI:67141) |
| hycanthone mesylate (CHEBI:24624) has role alkylating agent (CHEBI:22333) |
| hycanthone mesylate (CHEBI:24624) has role mutagen (CHEBI:25435) |
| hycanthone mesylate (CHEBI:24624) has role schistosomicide drug (CHEBI:38941) |
| hycanthone mesylate (CHEBI:24624) is a methanesulfonate salt (CHEBI:38037) |
| IUPAC Name |
|---|
| 1-{[2-(diethylamino)ethyl]amino}-4-(hydroxymethyl)-10H-dibenzo[b,e]thiopyran-10-one methanesulfonate |
| Synonyms | Source |
|---|---|
| N-[2-(diethylamino)ethyl]-4-methoxy-9-oxoxanthene-1-amine monomethanesulfonate | ChEBI |
| N,N-diethyl-2-{[4-(hydroxymethyl)-10-oxo-10H-dibenzo[b,e]thiopyran-1-yl]amino}ethanaminium methanesulfonate | IUPAC |
| hycanthone methanesulfonate | ChemIDplus |
| hycanthone methanesulphonate | ChemIDplus |
| hycanthone monomesylate | ChEBI |
| hycanthone monomethanesulfonate | ChemIDplus |
| Brand Name | Source |
|---|---|
| Etrenol | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C19432 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4096157 | Reaxys |
| CAS:23255-93-8 | KEGG COMPOUND |
| CAS:23255-93-8 | ChemIDplus |
| Citations |
|---|