EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H24N2O2S |
| Net Charge | 0 |
| Average Mass | 356.491 |
| Monoisotopic Mass | 356.15585 |
| SMILES | CCN(CC)CCNc1ccc(CO)c2sc3ccccc3c(=O)c12 |
| InChI | InChI=1S/C20H24N2O2S/c1-3-22(4-2)12-11-21-16-10-9-14(13-23)20-18(16)19(24)15-7-5-6-8-17(15)25-20/h5-10,21,23H,3-4,11-13H2,1-2H3 |
| InChIKey | MFZWMTSUNYWVBU-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | mutagen An agent that increases the frequency of mutations above the normal background level, usually by interacting directly with DNA and causing it damage, including base substitution. |
| Application: | schistosomicide drug Drugs that used to treat infestations by flukes (trematodes) of the genus Schistosoma. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| hycanthone (CHEBI:52768) has functional parent lucanthone (CHEBI:51052) |
| hycanthone (CHEBI:52768) has role mutagen (CHEBI:25435) |
| hycanthone (CHEBI:52768) has role schistosomicide drug (CHEBI:38941) |
| hycanthone (CHEBI:52768) is a thioxanthenes (CHEBI:50930) |
| hycanthone (CHEBI:52768) is conjugate base of hycanthone(1+) (CHEBI:67141) |
| Incoming Relation(s) |
| hycanthone(1+) (CHEBI:67141) is conjugate acid of hycanthone (CHEBI:52768) |
| IUPAC Name |
|---|
| 1-{[2-(diethylamino)ethyl]amino}-4-(hydroxymethyl)-9H-thioxanthen-9-one |
| INNs | Source |
|---|---|
| hicantona | ChemIDplus |
| hycanthone | WHO MedNet |
| hycanthone | KEGG DRUG |
| hycanthonum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 1-((2-(Diethylamino)ethyl)amino)-4-(hydroxymethyl)-9H-thioxanthen-9-one | ChemIDplus |
| 1-(2-diethylaminoethylamino)-4-(hydroxymethyl)thioxanthen-9-one | ChEBI |
| 1-((2-(Diethylamino)ethyl)amino)-4-(hydroxymethyl)thioxanthen-9-one | ChemIDplus |
| Hycanthon | ChemIDplus |
| Hycanthone | KEGG DRUG |
| Lucanthone metabolite | ChemIDplus |
| Citations |
|---|